\n
\n","\n
\n\n \n
\n \n
\n","import {\n ChangeDetectionStrategy,\n Component,\n EventEmitter,\n Input,\n Output,\n} from \"@angular/core\";\n\nimport { Footer } from \"../footer\";\nimport { Header } from \"../header\";\nimport { LanguageSelectOption } from \"../uncontrolled-select/types/language-select-option.interface\";\n\n@Component({\n selector: \"pax-layout\",\n standalone: true,\n imports: [Footer, Header],\n templateUrl: \"./layout.html\",\n styleUrls: [\"./layout.css\"],\n changeDetection: ChangeDetectionStrategy.OnPush,\n})\nexport class Layout {\n @Input() minimal?: boolean;\n @Input({ required: true }) acceptedLanguages!: LanguageSelectOption[];\n @Input() initialLanguage: LanguageSelectOption | undefined;\n\n @Output() changedLanguage = new EventEmitter();\n\n setLanguage(selectedLanguage: string) {\n this.changedLanguage.emit(selectedLanguage);\n }\n}\n","\n @for(notificationMessage of notificationMessages; track\n notificationMessage.id) {\n\n \n \n
\n\n }\n \n\n \n
\n\n \n @if(notificationMessage.text){\n {{ notificationMessage.text }} \n } @if(notificationMessage.markdown){\n {{ notificationMessage.markdown }} \n }\n
\n\n [Gesundheitsfragen](${underwritingQuestionPageUrl}:URL:)`;\n }\n}\n","import { Injectable } from \"@angular/core\";\nimport { QuoteFeatureState as Pillar3aQuoteFeatureState } from \"src/app/shared/store/quote/pillar-3a/quote.state\";\nimport { QuoteFeatureState as TermLifeInsuranceQuoteFeatureState } from \"src/app/shared/store/quote/term-life-insurance/quote.state\";\n\nimport { ApplicationFeatureState } from \"../../../store/application/application.state\";\nimport { NotificationMessagePayload } from \"../../../store/notification/notification.actions\";\nimport { NotificationMessage } from \"../../../store/notification/notification.state\";\n\nimport { NotificationCoreService } from \"../core/notification-core.service\";\nimport { CreateApplicationFailedNotificationService } from \"./notifications/create-application-failed-notification.service\";\n\n@Injectable({\n providedIn: \"root\",\n})\nexport class NotificationApplicationService {\n constructor(\n private readonly _createApplicationFailedNotificationService: CreateApplicationFailedNotificationService,\n ) {}\n\n createNotificationPayloads(\n previousApplicationFeatureState: ApplicationFeatureState,\n currentApplicationFeatureState: ApplicationFeatureState,\n currentTermLifeInsuranceQuoteFeatureState: TermLifeInsuranceQuoteFeatureState,\n _currentPillar3aQuoteFeatureState: Pillar3aQuoteFeatureState,\n _: NotificationMessage[] | undefined,\n ) {\n const notificationMessagePayloads: NotificationMessagePayload[] = [];\n\n const httpNotificationMessage =\n NotificationCoreService.tryCreateHttpNotificationMessage(\n previousApplicationFeatureState,\n currentApplicationFeatureState,\n );\n\n const hasUnderwritingQuestionsBeenResetNotificationMessage =\n this._createApplicationFailedNotificationService.tryCreateMissingUnderwritingQuestionNotificationMessage(\n currentApplicationFeatureState,\n currentTermLifeInsuranceQuoteFeatureState,\n );\n\n if (httpNotificationMessage) {\n notificationMessagePayloads.push(httpNotificationMessage);\n }\n\n if (hasUnderwritingQuestionsBeenResetNotificationMessage) {\n notificationMessagePayloads.push(\n hasUnderwritingQuestionsBeenResetNotificationMessage,\n );\n }\n\n return notificationMessagePayloads.length > 0\n ? notificationMessagePayloads\n : undefined;\n }\n}\n","import { Injectable } from \"@angular/core\";\nimport { Store } from \"@ngrx/store\";\nimport { map, pairwise, ReplaySubject, tap, withLatestFrom } from \"rxjs\";\nimport { AppState } from \"src/app/shared/store/app.state\";\nimport { ApplicationFeatureState } from \"src/app/shared/store/application/application.state\";\nimport * as ApplicationSelectors from \"../../../store/application/application.selectors\";\nimport * as NotificationSelectors from \"../../../store/notification/notification.selectors\";\nimport * as Pillar3aQuoteSelectors from \"../../../store/quote/pillar-3a/quote.selectors\";\nimport * as TermLifeInsuranceQuoteSelectors from \"../../../store/quote/term-life-insurance/quote.selectors\";\nimport { NotificationService } from \"../notification.service\";\nimport { NotificationApplicationService } from \"./notification-application.service\";\n\n@Injectable({\n providedIn: \"root\",\n})\nexport class NotificationPublisherService {\n private readonly _applicationFeatureStateReplaySubject =\n new ReplaySubject
\n \n
\n\n \n @if (backgroundSubscriptionNavigationService.isNavigationOngoing$ | async) {\n \n
\n }\n\n \n @if (\n (backgroundSubscriptionNavigationService.isNavigationOngoing$ | async) ===\n false\n ) {\n ...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n * \n * \n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: AnimationMetadataType.Trigger, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: AnimationMetadataType.Animate, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: AnimationMetadataType.Group, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: AnimationMetadataType.Sequence, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: AnimationMetadataType.Style, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: AnimationMetadataType.State, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: AnimationMetadataType.Keyframes, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n * \n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```html\n * \n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```html\n * \n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: AnimationMetadataType.Transition, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: AnimationMetadataType.Reference, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: AnimationMetadataType.AnimateChild, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: AnimationMetadataType.AnimateRef, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave based on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n * \n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n * \n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n * \n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: AnimationMetadataType.Query, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n * Title
\n *\n * Blah blah blah\n *
\n * \n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: AnimationMetadataType.Stagger, timings, animation };\n}\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the \n * {{ item }}\n *
\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)() method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: AnimationBuilder, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: AnimationBuilder, providedIn: 'root', useFactory: () => inject(BrowserAnimationBuilder) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: AnimationBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(BrowserAnimationBuilder) }]\n }] });\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\nclass BrowserAnimationBuilder extends AnimationBuilder {\n constructor(rootRenderer, doc) {\n super();\n this.animationModuleType = inject(ANIMATION_MODULE_TYPE, { optional: true });\n this._nextAnimationId = 0;\n const typeData = {\n id: '0',\n encapsulation: ViewEncapsulation.None,\n styles: [],\n data: { animation: [] },\n };\n this._renderer = rootRenderer.createRenderer(doc.body, typeData);\n if (this.animationModuleType === null && !isAnimationRenderer(this._renderer)) {\n // We only support AnimationRenderer & DynamicDelegationRenderer for this AnimationBuilder\n throw new ɵRuntimeError(3600 /* RuntimeErrorCode.BROWSER_ANIMATION_BUILDER_INJECTED_WITHOUT_ANIMATIONS */, (typeof ngDevMode === 'undefined' || ngDevMode) &&\n 'Angular detected that the `AnimationBuilder` was injected, but animation support was not enabled. ' +\n 'Please make sure that you enable animations in your application by calling `provideAnimations()` or `provideAnimationsAsync()` function.');\n }\n }\n build(animation) {\n const id = this._nextAnimationId;\n this._nextAnimationId++;\n const entry = Array.isArray(animation) ? sequence(animation) : animation;\n issueAnimationCommand(this._renderer, null, id, 'register', [entry]);\n return new BrowserAnimationFactory(id, this._renderer);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserAnimationBuilder, deps: [{ token: i0.RendererFactory2 }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserAnimationBuilder, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserAnimationBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i0.RendererFactory2 }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }] });\nclass BrowserAnimationFactory extends AnimationFactory {\n constructor(_id, _renderer) {\n super();\n this._id = _id;\n this._renderer = _renderer;\n }\n create(element, options) {\n return new RendererAnimationPlayer(this._id, element, options || {}, this._renderer);\n }\n}\nclass RendererAnimationPlayer {\n constructor(id, element, options, _renderer) {\n this.id = id;\n this.element = element;\n this._renderer = _renderer;\n this.parentPlayer = null;\n this._started = false;\n this.totalTime = 0;\n this._command('create', options);\n }\n _listen(eventName, callback) {\n return this._renderer.listen(this.element, `@@${this.id}:${eventName}`, callback);\n }\n _command(command, ...args) {\n issueAnimationCommand(this._renderer, this.element, this.id, command, args);\n }\n onDone(fn) {\n this._listen('done', fn);\n }\n onStart(fn) {\n this._listen('start', fn);\n }\n onDestroy(fn) {\n this._listen('destroy', fn);\n }\n init() {\n this._command('init');\n }\n hasStarted() {\n return this._started;\n }\n play() {\n this._command('play');\n this._started = true;\n }\n pause() {\n this._command('pause');\n }\n restart() {\n this._command('restart');\n }\n finish() {\n this._command('finish');\n }\n destroy() {\n this._command('destroy');\n }\n reset() {\n this._command('reset');\n this._started = false;\n }\n setPosition(p) {\n this._command('setPosition', p);\n }\n getPosition() {\n return unwrapAnimationRenderer(this._renderer)?.engine?.players[this.id]?.getPosition() ?? 0;\n }\n}\nfunction issueAnimationCommand(renderer, element, id, command, args) {\n renderer.setProperty(element, `@@${id}:${command}`, args);\n}\n/**\n * The following 2 methods cannot reference their correct types (AnimationRenderer &\n * DynamicDelegationRenderer) since this would introduce a import cycle.\n */\nfunction unwrapAnimationRenderer(renderer) {\n const type = renderer.ɵtype;\n if (type === 0 /* AnimationRendererType.Regular */) {\n return renderer;\n }\n else if (type === 1 /* AnimationRendererType.Delegated */) {\n return renderer.animationRenderer;\n }\n return null;\n}\nfunction isAnimationRenderer(renderer) {\n const type = renderer.ɵtype;\n return type === 0 /* AnimationRendererType.Regular */ || type === 1 /* AnimationRendererType.Delegated */;\n}\n\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see {@link animate}\n * @see {@link AnimationPlayer}\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach((fn) => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n queueMicrotask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach((fn) => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach((fn) => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n this._finished = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach((fn) => fn());\n methods.length = 0;\n }\n}\n\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see {@link AnimationPlayer}\n * @see {@link animations/group group}\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n queueMicrotask(() => this._onFinish());\n }\n else {\n this.players.forEach((player) => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach((fn) => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach((player) => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach((fn) => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach((player) => player.play());\n }\n pause() {\n this.players.forEach((player) => player.pause());\n }\n restart() {\n this.players.forEach((player) => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach((player) => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach((player) => player.destroy());\n this._onDestroyFns.forEach((fn) => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach((player) => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach((player) => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach((player) => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach((fn) => fn());\n methods.length = 0;\n }\n}\n\nconst ɵPRE_STYLE = '!';\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, AnimationMetadataType, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, BrowserAnimationBuilder as ɵBrowserAnimationBuilder, ɵPRE_STYLE };\n","import { coerceElement, coerceNumberProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { Injectable, inject, NgZone, EventEmitter, booleanAttribute, Directive, Output, Input, NgModule } from '@angular/core';\nimport { Observable, Subject } from 'rxjs';\nimport { map, filter, debounceTime } from 'rxjs/operators';\n\n// Angular may add, remove, or edit comment nodes during change detection. We don't care about\n// these changes because they don't affect the user-preceived content, and worse it can cause\n// infinite change detection cycles where the change detection updates a comment, triggering the\n// MutationObserver, triggering another change detection and kicking the cycle off again.\nfunction shouldIgnoreRecord(record) {\n // Ignore changes to comment text.\n if (record.type === 'characterData' && record.target instanceof Comment) {\n return true;\n }\n // Ignore addition / removal of comments.\n if (record.type === 'childList') {\n for (let i = 0; i < record.addedNodes.length; i++) {\n if (!(record.addedNodes[i] instanceof Comment)) {\n return false;\n }\n }\n for (let i = 0; i < record.removedNodes.length; i++) {\n if (!(record.removedNodes[i] instanceof Comment)) {\n return false;\n }\n }\n return true;\n }\n // Observe everything else.\n return false;\n}\n/**\n * Factory that creates a new MutationObserver and allows us to stub it out in unit tests.\n * @docs-private\n */\nclass MutationObserverFactory {\n create(callback) {\n return typeof MutationObserver === 'undefined' ? null : new MutationObserver(callback);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MutationObserverFactory, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MutationObserverFactory, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MutationObserverFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/** An injectable service that allows watching elements for changes to their content. */\nclass ContentObserver {\n constructor(_mutationObserverFactory) {\n this._mutationObserverFactory = _mutationObserverFactory;\n /** Keeps track of the existing MutationObservers so they can be reused. */\n this._observedElements = new Map();\n this._ngZone = inject(NgZone);\n }\n ngOnDestroy() {\n this._observedElements.forEach((_, element) => this._cleanupObserver(element));\n }\n observe(elementOrRef) {\n const element = coerceElement(elementOrRef);\n return new Observable((observer) => {\n const stream = this._observeElement(element);\n const subscription = stream\n .pipe(map(records => records.filter(record => !shouldIgnoreRecord(record))), filter(records => !!records.length))\n .subscribe(records => {\n this._ngZone.run(() => {\n observer.next(records);\n });\n });\n return () => {\n subscription.unsubscribe();\n this._unobserveElement(element);\n };\n });\n }\n /**\n * Observes the given element by using the existing MutationObserver if available, or creating a\n * new one if not.\n */\n _observeElement(element) {\n return this._ngZone.runOutsideAngular(() => {\n if (!this._observedElements.has(element)) {\n const stream = new Subject();\n const observer = this._mutationObserverFactory.create(mutations => stream.next(mutations));\n if (observer) {\n observer.observe(element, {\n characterData: true,\n childList: true,\n subtree: true,\n });\n }\n this._observedElements.set(element, { observer, stream, count: 1 });\n }\n else {\n this._observedElements.get(element).count++;\n }\n return this._observedElements.get(element).stream;\n });\n }\n /**\n * Un-observes the given element and cleans up the underlying MutationObserver if nobody else is\n * observing this element.\n */\n _unobserveElement(element) {\n if (this._observedElements.has(element)) {\n this._observedElements.get(element).count--;\n if (!this._observedElements.get(element).count) {\n this._cleanupObserver(element);\n }\n }\n }\n /** Clean up the underlying MutationObserver for the specified element. */\n _cleanupObserver(element) {\n if (this._observedElements.has(element)) {\n const { observer, stream } = this._observedElements.get(element);\n if (observer) {\n observer.disconnect();\n }\n stream.complete();\n this._observedElements.delete(element);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ContentObserver, deps: [{ token: MutationObserverFactory }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ContentObserver, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ContentObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: MutationObserverFactory }] });\n/**\n * Directive that triggers a callback whenever the content of\n * its associated element has changed.\n */\nclass CdkObserveContent {\n /**\n * Whether observing content is disabled. This option can be used\n * to disconnect the underlying MutationObserver until it is needed.\n */\n get disabled() {\n return this._disabled;\n }\n set disabled(value) {\n this._disabled = value;\n this._disabled ? this._unsubscribe() : this._subscribe();\n }\n /** Debounce interval for emitting the changes. */\n get debounce() {\n return this._debounce;\n }\n set debounce(value) {\n this._debounce = coerceNumberProperty(value);\n this._subscribe();\n }\n constructor(_contentObserver, _elementRef) {\n this._contentObserver = _contentObserver;\n this._elementRef = _elementRef;\n /** Event emitted for each change in the element's content. */\n this.event = new EventEmitter();\n this._disabled = false;\n this._currentSubscription = null;\n }\n ngAfterContentInit() {\n if (!this._currentSubscription && !this.disabled) {\n this._subscribe();\n }\n }\n ngOnDestroy() {\n this._unsubscribe();\n }\n _subscribe() {\n this._unsubscribe();\n const stream = this._contentObserver.observe(this._elementRef);\n this._currentSubscription = (this.debounce ? stream.pipe(debounceTime(this.debounce)) : stream).subscribe(this.event);\n }\n _unsubscribe() {\n this._currentSubscription?.unsubscribe();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkObserveContent, deps: [{ token: ContentObserver }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkObserveContent, isStandalone: true, selector: \"[cdkObserveContent]\", inputs: { disabled: [\"cdkObserveContentDisabled\", \"disabled\", booleanAttribute], debounce: \"debounce\" }, outputs: { event: \"cdkObserveContent\" }, exportAs: [\"cdkObserveContent\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkObserveContent, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkObserveContent]',\n exportAs: 'cdkObserveContent',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: ContentObserver }, { type: i0.ElementRef }], propDecorators: { event: [{\n type: Output,\n args: ['cdkObserveContent']\n }], disabled: [{\n type: Input,\n args: [{ alias: 'cdkObserveContentDisabled', transform: booleanAttribute }]\n }], debounce: [{\n type: Input\n }] } });\nclass ObserversModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ObserversModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ObserversModule, imports: [CdkObserveContent], exports: [CdkObserveContent] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ObserversModule, providers: [MutationObserverFactory] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ObserversModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CdkObserveContent],\n exports: [CdkObserveContent],\n providers: [MutationObserverFactory],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkObserveContent, ContentObserver, MutationObserverFactory, ObserversModule };\n","import * as i0 from '@angular/core';\nimport { NgModule, CSP_NONCE, Injectable, Optional, Inject } from '@angular/core';\nimport { coerceArray } from '@angular/cdk/coercion';\nimport { Subject, combineLatest, concat, Observable } from 'rxjs';\nimport { take, skip, debounceTime, map, startWith, takeUntil } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\n\nclass LayoutModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LayoutModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LayoutModule }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LayoutModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LayoutModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/** Global registry for all dynamically-created, injected media queries. */\nconst mediaQueriesForWebkitCompatibility = new Set();\n/** Style tag that holds all of the dynamically-created media queries. */\nlet mediaQueryStyleNode;\n/** A utility for calling matchMedia queries. */\nclass MediaMatcher {\n constructor(_platform, _nonce) {\n this._platform = _platform;\n this._nonce = _nonce;\n this._matchMedia =\n this._platform.isBrowser && window.matchMedia\n ? // matchMedia is bound to the window scope intentionally as it is an illegal invocation to\n // call it from a different scope.\n window.matchMedia.bind(window)\n : noopMatchMedia;\n }\n /**\n * Evaluates the given media query and returns the native MediaQueryList from which results\n * can be retrieved.\n * Confirms the layout engine will trigger for the selector query provided and returns the\n * MediaQueryList for the query provided.\n */\n matchMedia(query) {\n if (this._platform.WEBKIT || this._platform.BLINK) {\n createEmptyStyleRule(query, this._nonce);\n }\n return this._matchMedia(query);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MediaMatcher, deps: [{ token: i1.Platform }, { token: CSP_NONCE, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MediaMatcher, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: MediaMatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [CSP_NONCE]\n }] }] });\n/**\n * Creates an empty stylesheet that is used to work around browser inconsistencies related to\n * `matchMedia`. At the time of writing, it handles the following cases:\n * 1. On WebKit browsers, a media query has to have at least one rule in order for `matchMedia`\n * to fire. We work around it by declaring a dummy stylesheet with a `@media` declaration.\n * 2. In some cases Blink browsers will stop firing the `matchMedia` listener if none of the rules\n * inside the `@media` match existing elements on the page. We work around it by having one rule\n * targeting the `body`. See https://github.com/angular/components/issues/23546.\n */\nfunction createEmptyStyleRule(query, nonce) {\n if (mediaQueriesForWebkitCompatibility.has(query)) {\n return;\n }\n try {\n if (!mediaQueryStyleNode) {\n mediaQueryStyleNode = document.createElement('style');\n if (nonce) {\n mediaQueryStyleNode.setAttribute('nonce', nonce);\n }\n mediaQueryStyleNode.setAttribute('type', 'text/css');\n document.head.appendChild(mediaQueryStyleNode);\n }\n if (mediaQueryStyleNode.sheet) {\n mediaQueryStyleNode.sheet.insertRule(`@media ${query} {body{ }}`, 0);\n mediaQueriesForWebkitCompatibility.add(query);\n }\n }\n catch (e) {\n console.error(e);\n }\n}\n/** No-op matchMedia replacement for non-browser platforms. */\nfunction noopMatchMedia(query) {\n // Use `as any` here to avoid adding additional necessary properties for\n // the noop matcher.\n return {\n matches: query === 'all' || query === '',\n media: query,\n addListener: () => { },\n removeListener: () => { },\n };\n}\n\n/** Utility for checking the matching state of @media queries. */\nclass BreakpointObserver {\n constructor(_mediaMatcher, _zone) {\n this._mediaMatcher = _mediaMatcher;\n this._zone = _zone;\n /** A map of all media queries currently being listened for. */\n this._queries = new Map();\n /** A subject for all other observables to takeUntil based on. */\n this._destroySubject = new Subject();\n }\n /** Completes the active subject, signalling to all other observables to complete. */\n ngOnDestroy() {\n this._destroySubject.next();\n this._destroySubject.complete();\n }\n /**\n * Whether one or more media queries match the current viewport size.\n * @param value One or more media queries to check.\n * @returns Whether any of the media queries match.\n */\n isMatched(value) {\n const queries = splitQueries(coerceArray(value));\n return queries.some(mediaQuery => this._registerQuery(mediaQuery).mql.matches);\n }\n /**\n * Gets an observable of results for the given queries that will emit new results for any changes\n * in matching of the given queries.\n * @param value One or more media queries to check.\n * @returns A stream of matches for the given queries.\n */\n observe(value) {\n const queries = splitQueries(coerceArray(value));\n const observables = queries.map(query => this._registerQuery(query).observable);\n let stateObservable = combineLatest(observables);\n // Emit the first state immediately, and then debounce the subsequent emissions.\n stateObservable = concat(stateObservable.pipe(take(1)), stateObservable.pipe(skip(1), debounceTime(0)));\n return stateObservable.pipe(map(breakpointStates => {\n const response = {\n matches: false,\n breakpoints: {},\n };\n breakpointStates.forEach(({ matches, query }) => {\n response.matches = response.matches || matches;\n response.breakpoints[query] = matches;\n });\n return response;\n }));\n }\n /** Registers a specific query to be listened for. */\n _registerQuery(query) {\n // Only set up a new MediaQueryList if it is not already being listened for.\n if (this._queries.has(query)) {\n return this._queries.get(query);\n }\n const mql = this._mediaMatcher.matchMedia(query);\n // Create callback for match changes and add it is as a listener.\n const queryObservable = new Observable((observer) => {\n // Listener callback methods are wrapped to be placed back in ngZone. Callbacks must be placed\n // back into the zone because matchMedia is only included in Zone.js by loading the\n // webapis-media-query.js file alongside the zone.js file. Additionally, some browsers do not\n // have MediaQueryList inherit from EventTarget, which causes inconsistencies in how Zone.js\n // patches it.\n const handler = (e) => this._zone.run(() => observer.next(e));\n mql.addListener(handler);\n return () => {\n mql.removeListener(handler);\n };\n }).pipe(startWith(mql), map(({ matches }) => ({ query, matches })), takeUntil(this._destroySubject));\n // Add the MediaQueryList to the set of queries.\n const output = { observable: queryObservable, mql };\n this._queries.set(query, output);\n return output;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BreakpointObserver, deps: [{ token: MediaMatcher }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BreakpointObserver, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BreakpointObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: MediaMatcher }, { type: i0.NgZone }] });\n/**\n * Split each query string into separate query strings if two queries are provided as comma\n * separated.\n */\nfunction splitQueries(queries) {\n return queries\n .map(query => query.split(','))\n .reduce((a1, a2) => a1.concat(a2))\n .map(query => query.trim());\n}\n\n// PascalCase is being used as Breakpoints is used like an enum.\n// tslint:disable-next-line:variable-name\nconst Breakpoints = {\n XSmall: '(max-width: 599.98px)',\n Small: '(min-width: 600px) and (max-width: 959.98px)',\n Medium: '(min-width: 960px) and (max-width: 1279.98px)',\n Large: '(min-width: 1280px) and (max-width: 1919.98px)',\n XLarge: '(min-width: 1920px)',\n Handset: '(max-width: 599.98px) and (orientation: portrait), ' +\n '(max-width: 959.98px) and (orientation: landscape)',\n Tablet: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait), ' +\n '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n Web: '(min-width: 840px) and (orientation: portrait), ' +\n '(min-width: 1280px) and (orientation: landscape)',\n HandsetPortrait: '(max-width: 599.98px) and (orientation: portrait)',\n TabletPortrait: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait)',\n WebPortrait: '(min-width: 840px) and (orientation: portrait)',\n HandsetLandscape: '(max-width: 959.98px) and (orientation: landscape)',\n TabletLandscape: '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n WebLandscape: '(min-width: 1280px) and (orientation: landscape)',\n};\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BreakpointObserver, Breakpoints, LayoutModule, MediaMatcher };\n","import { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { inject, APP_ID, Injectable, Inject, QueryList, isSignal, effect, InjectionToken, afterNextRender, Injector, booleanAttribute, Directive, Input, Optional, EventEmitter, Output, NgModule } from '@angular/core';\nimport * as i1 from '@angular/cdk/platform';\nimport { Platform, _getFocusedElementPierceShadowDom, normalizePassiveListenerOptions, _getEventTarget, _getShadowRoot } from '@angular/cdk/platform';\nimport { Subject, Subscription, isObservable, of, BehaviorSubject } from 'rxjs';\nimport { A, Z, ZERO, NINE, hasModifierKey, PAGE_DOWN, PAGE_UP, END, HOME, LEFT_ARROW, RIGHT_ARROW, UP_ARROW, DOWN_ARROW, TAB, ALT, CONTROL, MAC_META, META, SHIFT } from '@angular/cdk/keycodes';\nimport { tap, debounceTime, filter, map, take, skip, distinctUntilChanged, takeUntil } from 'rxjs/operators';\nimport { coerceObservable } from '@angular/cdk/coercion/private';\nimport * as i1$1 from '@angular/cdk/observers';\nimport { ObserversModule } from '@angular/cdk/observers';\nimport { coerceElement } from '@angular/cdk/coercion';\nimport { BreakpointObserver } from '@angular/cdk/layout';\n\n/** IDs are delimited by an empty space, as per the spec. */\nconst ID_DELIMITER = ' ';\n/**\n * Adds the given ID to the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction addAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n id = id.trim();\n if (ids.some(existingId => existingId.trim() === id)) {\n return;\n }\n ids.push(id);\n el.setAttribute(attr, ids.join(ID_DELIMITER));\n}\n/**\n * Removes the given ID from the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction removeAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n id = id.trim();\n const filteredIds = ids.filter(val => val !== id);\n if (filteredIds.length) {\n el.setAttribute(attr, filteredIds.join(ID_DELIMITER));\n }\n else {\n el.removeAttribute(attr);\n }\n}\n/**\n * Gets the list of IDs referenced by the given ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction getAriaReferenceIds(el, attr) {\n // Get string array of all individual ids (whitespace delimited) in the attribute value\n const attrValue = el.getAttribute(attr);\n return attrValue?.match(/\\S+/g) ?? [];\n}\n\n/**\n * ID used for the body container where all messages are appended.\n * @deprecated No longer being used. To be removed.\n * @breaking-change 14.0.0\n */\nconst MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container';\n/**\n * ID prefix used for each created message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message';\n/**\n * Attribute given to each host element that is described by a message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host';\n/** Global incremental identifier for each registered message element. */\nlet nextId = 0;\n/**\n * Utility that creates visually hidden elements with a message content. Useful for elements that\n * want to use aria-describedby to further describe themselves without adding additional visual\n * content.\n */\nclass AriaDescriber {\n constructor(_document, \n /**\n * @deprecated To be turned into a required parameter.\n * @breaking-change 14.0.0\n */\n _platform) {\n this._platform = _platform;\n /** Map of all registered message elements that have been placed into the document. */\n this._messageRegistry = new Map();\n /** Container for all registered messages. */\n this._messagesContainer = null;\n /** Unique ID for the service. */\n this._id = `${nextId++}`;\n this._document = _document;\n this._id = inject(APP_ID) + '-' + nextId++;\n }\n describe(hostElement, message, role) {\n if (!this._canBeDescribed(hostElement, message)) {\n return;\n }\n const key = getKey(message, role);\n if (typeof message !== 'string') {\n // We need to ensure that the element has an ID.\n setMessageId(message, this._id);\n this._messageRegistry.set(key, { messageElement: message, referenceCount: 0 });\n }\n else if (!this._messageRegistry.has(key)) {\n this._createMessageElement(message, role);\n }\n if (!this._isElementDescribedByMessage(hostElement, key)) {\n this._addMessageReference(hostElement, key);\n }\n }\n removeDescription(hostElement, message, role) {\n if (!message || !this._isElementNode(hostElement)) {\n return;\n }\n const key = getKey(message, role);\n if (this._isElementDescribedByMessage(hostElement, key)) {\n this._removeMessageReference(hostElement, key);\n }\n // If the message is a string, it means that it's one that we created for the\n // consumer so we can remove it safely, otherwise we should leave it in place.\n if (typeof message === 'string') {\n const registeredMessage = this._messageRegistry.get(key);\n if (registeredMessage && registeredMessage.referenceCount === 0) {\n this._deleteMessageElement(key);\n }\n }\n if (this._messagesContainer?.childNodes.length === 0) {\n this._messagesContainer.remove();\n this._messagesContainer = null;\n }\n }\n /** Unregisters all created message elements and removes the message container. */\n ngOnDestroy() {\n const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}=\"${this._id}\"]`);\n for (let i = 0; i < describedElements.length; i++) {\n this._removeCdkDescribedByReferenceIds(describedElements[i]);\n describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n this._messagesContainer?.remove();\n this._messagesContainer = null;\n this._messageRegistry.clear();\n }\n /**\n * Creates a new element in the visually hidden message container element with the message\n * as its content and adds it to the message registry.\n */\n _createMessageElement(message, role) {\n const messageElement = this._document.createElement('div');\n setMessageId(messageElement, this._id);\n messageElement.textContent = message;\n if (role) {\n messageElement.setAttribute('role', role);\n }\n this._createMessagesContainer();\n this._messagesContainer.appendChild(messageElement);\n this._messageRegistry.set(getKey(message, role), { messageElement, referenceCount: 0 });\n }\n /** Deletes the message element from the global messages container. */\n _deleteMessageElement(key) {\n this._messageRegistry.get(key)?.messageElement?.remove();\n this._messageRegistry.delete(key);\n }\n /** Creates the global container for all aria-describedby messages. */\n _createMessagesContainer() {\n if (this._messagesContainer) {\n return;\n }\n const containerClassName = 'cdk-describedby-message-container';\n const serverContainers = this._document.querySelectorAll(`.${containerClassName}[platform=\"server\"]`);\n for (let i = 0; i < serverContainers.length; i++) {\n // When going from the server to the client, we may end up in a situation where there's\n // already a container on the page, but we don't have a reference to it. Clear the\n // old container so we don't get duplicates. Doing this, instead of emptying the previous\n // container, should be slightly faster.\n serverContainers[i].remove();\n }\n const messagesContainer = this._document.createElement('div');\n // We add `visibility: hidden` in order to prevent text in this container from\n // being searchable by the browser's Ctrl + F functionality.\n // Screen-readers will still read the description for elements with aria-describedby even\n // when the description element is not visible.\n messagesContainer.style.visibility = 'hidden';\n // Even though we use `visibility: hidden`, we still apply `cdk-visually-hidden` so that\n // the description element doesn't impact page layout.\n messagesContainer.classList.add(containerClassName);\n messagesContainer.classList.add('cdk-visually-hidden');\n // @breaking-change 14.0.0 Remove null check for `_platform`.\n if (this._platform && !this._platform.isBrowser) {\n messagesContainer.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(messagesContainer);\n this._messagesContainer = messagesContainer;\n }\n /** Removes all cdk-describedby messages that are hosted through the element. */\n _removeCdkDescribedByReferenceIds(element) {\n // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX\n const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby').filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0);\n element.setAttribute('aria-describedby', originalReferenceIds.join(' '));\n }\n /**\n * Adds a message reference to the element using aria-describedby and increments the registered\n * message's reference count.\n */\n _addMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n // Add the aria-describedby reference and set the\n // describedby_host attribute to mark the element.\n addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, this._id);\n registeredMessage.referenceCount++;\n }\n /**\n * Removes a message reference from the element using aria-describedby\n * and decrements the registered message's reference count.\n */\n _removeMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n registeredMessage.referenceCount--;\n removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n /** Returns true if the element has been described by the provided message ID. */\n _isElementDescribedByMessage(element, key) {\n const referenceIds = getAriaReferenceIds(element, 'aria-describedby');\n const registeredMessage = this._messageRegistry.get(key);\n const messageId = registeredMessage && registeredMessage.messageElement.id;\n return !!messageId && referenceIds.indexOf(messageId) != -1;\n }\n /** Determines whether a message can be described on a particular element. */\n _canBeDescribed(element, message) {\n if (!this._isElementNode(element)) {\n return false;\n }\n if (message && typeof message === 'object') {\n // We'd have to make some assumptions about the description element's text, if the consumer\n // passed in an element. Assume that if an element is passed in, the consumer has verified\n // that it can be used as a description.\n return true;\n }\n const trimmedMessage = message == null ? '' : `${message}`.trim();\n const ariaLabel = element.getAttribute('aria-label');\n // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the\n // element, because screen readers will end up reading out the same text twice in a row.\n return trimmedMessage ? !ariaLabel || ariaLabel.trim() !== trimmedMessage : false;\n }\n /** Checks whether a node is an Element node. */\n _isElementNode(element) {\n return element.nodeType === this._document.ELEMENT_NODE;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AriaDescriber, deps: [{ token: DOCUMENT }, { token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AriaDescriber, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AriaDescriber, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1.Platform }] });\n/** Gets a key that can be used to look messages up in the registry. */\nfunction getKey(message, role) {\n return typeof message === 'string' ? `${role || ''}/${message}` : message;\n}\n/** Assigns a unique ID to an element, if it doesn't have one already. */\nfunction setMessageId(element, serviceId) {\n if (!element.id) {\n element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${serviceId}-${nextId++}`;\n }\n}\n\nconst DEFAULT_TYPEAHEAD_DEBOUNCE_INTERVAL_MS = 200;\n/**\n * Selects items based on keyboard inputs. Implements the typeahead functionality of\n * `role=\"listbox\"` or `role=\"tree\"` and other related roles.\n */\nclass Typeahead {\n constructor(initialItems, config) {\n this._letterKeyStream = new Subject();\n this._items = [];\n this._selectedItemIndex = -1;\n /** Buffer for the letters that the user has pressed */\n this._pressedLetters = [];\n this._selectedItem = new Subject();\n this.selectedItem = this._selectedItem;\n const typeAheadInterval = typeof config?.debounceInterval === 'number'\n ? config.debounceInterval\n : DEFAULT_TYPEAHEAD_DEBOUNCE_INTERVAL_MS;\n if (config?.skipPredicate) {\n this._skipPredicateFn = config.skipPredicate;\n }\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n initialItems.length &&\n initialItems.some(item => typeof item.getLabel !== 'function')) {\n throw new Error('KeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n this.setItems(initialItems);\n this._setupKeyHandler(typeAheadInterval);\n }\n destroy() {\n this._pressedLetters = [];\n this._letterKeyStream.complete();\n this._selectedItem.complete();\n }\n setCurrentSelectedItemIndex(index) {\n this._selectedItemIndex = index;\n }\n setItems(items) {\n this._items = items;\n }\n handleKey(event) {\n const keyCode = event.keyCode;\n // Attempt to use the `event.key` which also maps it to the user's keyboard language,\n // otherwise fall back to resolving alphanumeric characters via the keyCode.\n if (event.key && event.key.length === 1) {\n this._letterKeyStream.next(event.key.toLocaleUpperCase());\n }\n else if ((keyCode >= A && keyCode <= Z) || (keyCode >= ZERO && keyCode <= NINE)) {\n this._letterKeyStream.next(String.fromCharCode(keyCode));\n }\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return this._pressedLetters.length > 0;\n }\n /** Resets the currently stored sequence of typed letters. */\n reset() {\n this._pressedLetters = [];\n }\n _setupKeyHandler(typeAheadInterval) {\n // Debounce the presses of non-navigational keys, collect the ones that correspond to letters\n // and convert those letters back into a string. Afterwards find the first item that starts\n // with that string and select it.\n this._letterKeyStream\n .pipe(tap(letter => this._pressedLetters.push(letter)), debounceTime(typeAheadInterval), filter(() => this._pressedLetters.length > 0), map(() => this._pressedLetters.join('').toLocaleUpperCase()))\n .subscribe(inputString => {\n // Start at 1 because we want to start searching at the item immediately\n // following the current active item.\n for (let i = 1; i < this._items.length + 1; i++) {\n const index = (this._selectedItemIndex + i) % this._items.length;\n const item = this._items[index];\n if (!this._skipPredicateFn?.(item) &&\n item.getLabel?.().toLocaleUpperCase().trim().indexOf(inputString) === 0) {\n this._selectedItem.next(item);\n break;\n }\n }\n this._pressedLetters = [];\n });\n }\n}\n\n/**\n * This class manages keyboard events for selectable lists. If you pass it a query list\n * of items, it will set the active item correctly when arrow events occur.\n */\nclass ListKeyManager {\n constructor(_items, injector) {\n this._items = _items;\n this._activeItemIndex = -1;\n this._activeItem = null;\n this._wrap = false;\n this._typeaheadSubscription = Subscription.EMPTY;\n this._vertical = true;\n this._allowedModifierKeys = [];\n this._homeAndEnd = false;\n this._pageUpAndDown = { enabled: false, delta: 10 };\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager. By default, disabled items are skipped.\n */\n this._skipPredicateFn = (item) => item.disabled;\n /**\n * Stream that emits any time the TAB key is pressed, so components can react\n * when focus is shifted off of the list.\n */\n this.tabOut = new Subject();\n /** Stream that emits whenever the active item of the list manager changes. */\n this.change = new Subject();\n // We allow for the items to be an array because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (_items instanceof QueryList) {\n this._itemChangesSubscription = _items.changes.subscribe((newItems) => this._itemsChanged(newItems.toArray()));\n }\n else if (isSignal(_items)) {\n if (!injector && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw new Error('ListKeyManager constructed with a signal must receive an injector');\n }\n this._effectRef = effect(() => this._itemsChanged(_items()), { injector });\n }\n }\n /**\n * Sets the predicate function that determines which items should be skipped by the\n * list key manager.\n * @param predicate Function that determines whether the given item should be skipped.\n */\n skipPredicate(predicate) {\n this._skipPredicateFn = predicate;\n return this;\n }\n /**\n * Configures wrapping mode, which determines whether the active item will wrap to\n * the other end of list when there are no more items in the given direction.\n * @param shouldWrap Whether the list should wrap when reaching the end.\n */\n withWrap(shouldWrap = true) {\n this._wrap = shouldWrap;\n return this;\n }\n /**\n * Configures whether the key manager should be able to move the selection vertically.\n * @param enabled Whether vertical selection should be enabled.\n */\n withVerticalOrientation(enabled = true) {\n this._vertical = enabled;\n return this;\n }\n /**\n * Configures the key manager to move the selection horizontally.\n * Passing in `null` will disable horizontal movement.\n * @param direction Direction in which the selection can be moved.\n */\n withHorizontalOrientation(direction) {\n this._horizontal = direction;\n return this;\n }\n /**\n * Modifier keys which are allowed to be held down and whose default actions will be prevented\n * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys.\n */\n withAllowedModifierKeys(keys) {\n this._allowedModifierKeys = keys;\n return this;\n }\n /**\n * Turns on typeahead mode which allows users to set the active item by typing.\n * @param debounceInterval Time to wait after the last keystroke before setting the active item.\n */\n withTypeAhead(debounceInterval = 200) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n const items = this._getItemsArray();\n if (items.length > 0 && items.some(item => typeof item.getLabel !== 'function')) {\n throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n }\n this._typeaheadSubscription.unsubscribe();\n const items = this._getItemsArray();\n this._typeahead = new Typeahead(items, {\n debounceInterval: typeof debounceInterval === 'number' ? debounceInterval : undefined,\n skipPredicate: item => this._skipPredicateFn(item),\n });\n this._typeaheadSubscription = this._typeahead.selectedItem.subscribe(item => {\n this.setActiveItem(item);\n });\n return this;\n }\n /** Cancels the current typeahead sequence. */\n cancelTypeahead() {\n this._typeahead?.reset();\n return this;\n }\n /**\n * Configures the key manager to activate the first and last items\n * respectively when the Home or End key is pressed.\n * @param enabled Whether pressing the Home or End key activates the first/last item.\n */\n withHomeAndEnd(enabled = true) {\n this._homeAndEnd = enabled;\n return this;\n }\n /**\n * Configures the key manager to activate every 10th, configured or first/last element in up/down direction\n * respectively when the Page-Up or Page-Down key is pressed.\n * @param enabled Whether pressing the Page-Up or Page-Down key activates the first/last item.\n * @param delta Whether pressing the Home or End key activates the first/last item.\n */\n withPageUpDown(enabled = true, delta = 10) {\n this._pageUpAndDown = { enabled, delta };\n return this;\n }\n setActiveItem(item) {\n const previousActiveItem = this._activeItem;\n this.updateActiveItem(item);\n if (this._activeItem !== previousActiveItem) {\n this.change.next(this._activeItemIndex);\n }\n }\n /**\n * Sets the active item depending on the key event passed in.\n * @param event Keyboard event to be used for determining which element should be active.\n */\n onKeydown(event) {\n const keyCode = event.keyCode;\n const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey'];\n const isModifierAllowed = modifiers.every(modifier => {\n return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1;\n });\n switch (keyCode) {\n case TAB:\n this.tabOut.next();\n return;\n case DOWN_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case UP_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case RIGHT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case LEFT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case HOME:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setFirstItemActive();\n break;\n }\n else {\n return;\n }\n case END:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setLastItemActive();\n break;\n }\n else {\n return;\n }\n case PAGE_UP:\n if (this._pageUpAndDown.enabled && isModifierAllowed) {\n const targetIndex = this._activeItemIndex - this._pageUpAndDown.delta;\n this._setActiveItemByIndex(targetIndex > 0 ? targetIndex : 0, 1);\n break;\n }\n else {\n return;\n }\n case PAGE_DOWN:\n if (this._pageUpAndDown.enabled && isModifierAllowed) {\n const targetIndex = this._activeItemIndex + this._pageUpAndDown.delta;\n const itemsLength = this._getItemsArray().length;\n this._setActiveItemByIndex(targetIndex < itemsLength ? targetIndex : itemsLength - 1, -1);\n break;\n }\n else {\n return;\n }\n default:\n if (isModifierAllowed || hasModifierKey(event, 'shiftKey')) {\n this._typeahead?.handleKey(event);\n }\n // Note that we return here, in order to avoid preventing\n // the default action of non-navigational keys.\n return;\n }\n this._typeahead?.reset();\n event.preventDefault();\n }\n /** Index of the currently active item. */\n get activeItemIndex() {\n return this._activeItemIndex;\n }\n /** The active item. */\n get activeItem() {\n return this._activeItem;\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return !!this._typeahead && this._typeahead.isTyping();\n }\n /** Sets the active item to the first enabled item in the list. */\n setFirstItemActive() {\n this._setActiveItemByIndex(0, 1);\n }\n /** Sets the active item to the last enabled item in the list. */\n setLastItemActive() {\n this._setActiveItemByIndex(this._getItemsArray().length - 1, -1);\n }\n /** Sets the active item to the next enabled item in the list. */\n setNextItemActive() {\n this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1);\n }\n /** Sets the active item to a previous enabled item in the list. */\n setPreviousItemActive() {\n this._activeItemIndex < 0 && this._wrap\n ? this.setLastItemActive()\n : this._setActiveItemByDelta(-1);\n }\n updateActiveItem(item) {\n const itemArray = this._getItemsArray();\n const index = typeof item === 'number' ? item : itemArray.indexOf(item);\n const activeItem = itemArray[index];\n // Explicitly check for `null` and `undefined` because other falsy values are valid.\n this._activeItem = activeItem == null ? null : activeItem;\n this._activeItemIndex = index;\n this._typeahead?.setCurrentSelectedItemIndex(index);\n }\n /** Cleans up the key manager. */\n destroy() {\n this._typeaheadSubscription.unsubscribe();\n this._itemChangesSubscription?.unsubscribe();\n this._effectRef?.destroy();\n this._typeahead?.destroy();\n this.tabOut.complete();\n this.change.complete();\n }\n /**\n * This method sets the active item, given a list of items and the delta between the\n * currently active item and the new active item. It will calculate differently\n * depending on whether wrap mode is turned on.\n */\n _setActiveItemByDelta(delta) {\n this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta);\n }\n /**\n * Sets the active item properly given \"wrap\" mode. In other words, it will continue to move\n * down the list until it finds an item that is not disabled, and it will wrap if it\n * encounters either end of the list.\n */\n _setActiveInWrapMode(delta) {\n const items = this._getItemsArray();\n for (let i = 1; i <= items.length; i++) {\n const index = (this._activeItemIndex + delta * i + items.length) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item)) {\n this.setActiveItem(index);\n return;\n }\n }\n }\n /**\n * Sets the active item properly given the default mode. In other words, it will\n * continue to move down the list until it finds an item that is not disabled. If\n * it encounters either end of the list, it will stop and not wrap.\n */\n _setActiveInDefaultMode(delta) {\n this._setActiveItemByIndex(this._activeItemIndex + delta, delta);\n }\n /**\n * Sets the active item to the first enabled item starting at the index specified. If the\n * item is disabled, it will move in the fallbackDelta direction until it either\n * finds an enabled item or encounters the end of the list.\n */\n _setActiveItemByIndex(index, fallbackDelta) {\n const items = this._getItemsArray();\n if (!items[index]) {\n return;\n }\n while (this._skipPredicateFn(items[index])) {\n index += fallbackDelta;\n if (!items[index]) {\n return;\n }\n }\n this.setActiveItem(index);\n }\n /** Returns the items as an array. */\n _getItemsArray() {\n if (isSignal(this._items)) {\n return this._items();\n }\n return this._items instanceof QueryList ? this._items.toArray() : this._items;\n }\n /** Callback for when the items have changed. */\n _itemsChanged(newItems) {\n this._typeahead?.setItems(newItems);\n if (this._activeItem) {\n const newIndex = newItems.indexOf(this._activeItem);\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n this._typeahead?.setCurrentSelectedItemIndex(newIndex);\n }\n }\n }\n}\n\nclass ActiveDescendantKeyManager extends ListKeyManager {\n setActiveItem(index) {\n if (this.activeItem) {\n this.activeItem.setInactiveStyles();\n }\n super.setActiveItem(index);\n if (this.activeItem) {\n this.activeItem.setActiveStyles();\n }\n }\n}\n\nclass FocusKeyManager extends ListKeyManager {\n constructor() {\n super(...arguments);\n this._origin = 'program';\n }\n /**\n * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls.\n * @param origin Focus origin to be used when focusing items.\n */\n setFocusOrigin(origin) {\n this._origin = origin;\n return this;\n }\n setActiveItem(item) {\n super.setActiveItem(item);\n if (this.activeItem) {\n this.activeItem.focus(this._origin);\n }\n }\n}\n\n/**\n * This class manages keyboard events for trees. If you pass it a QueryList or other list of tree\n * items, it will set the active item, focus, handle expansion and typeahead correctly when\n * keyboard events occur.\n */\nclass TreeKeyManager {\n _initializeFocus() {\n if (this._hasInitialFocused || this._items.length === 0) {\n return;\n }\n let activeIndex = 0;\n for (let i = 0; i < this._items.length; i++) {\n if (!this._skipPredicateFn(this._items[i]) && !this._isItemDisabled(this._items[i])) {\n activeIndex = i;\n break;\n }\n }\n const activeItem = this._items[activeIndex];\n // Use `makeFocusable` here, because we want the item to just be focusable, not actually\n // capture the focus since the user isn't interacting with it. See #29628.\n if (activeItem.makeFocusable) {\n this._activeItem?.unfocus();\n this._activeItemIndex = activeIndex;\n this._activeItem = activeItem;\n this._typeahead?.setCurrentSelectedItemIndex(activeIndex);\n activeItem.makeFocusable();\n }\n else {\n // Backwards compatibility for items that don't implement `makeFocusable`.\n this.focusItem(activeIndex);\n }\n this._hasInitialFocused = true;\n }\n /**\n *\n * @param items List of TreeKeyManager options. Can be synchronous or asynchronous.\n * @param config Optional configuration options. By default, use 'ltr' horizontal orientation. By\n * default, do not skip any nodes. By default, key manager only calls `focus` method when items\n * are focused and does not call `activate`. If `typeaheadDefaultInterval` is `true`, use a\n * default interval of 200ms.\n */\n constructor(items, config) {\n /** The index of the currently active (focused) item. */\n this._activeItemIndex = -1;\n /** The currently active (focused) item. */\n this._activeItem = null;\n /** Whether or not we activate the item when it's focused. */\n this._shouldActivationFollowFocus = false;\n /**\n * The orientation that the tree is laid out in. In `rtl` mode, the behavior of Left and\n * Right arrow are switched.\n */\n this._horizontalOrientation = 'ltr';\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager.\n *\n * The default value for this doesn't skip any elements in order to keep tree items focusable\n * when disabled. This aligns with ARIA guidelines:\n * https://www.w3.org/WAI/ARIA/apg/practices/keyboard-interface/#focusabilityofdisabledcontrols.\n */\n this._skipPredicateFn = (_item) => false;\n /** Function to determine equivalent items. */\n this._trackByFn = (item) => item;\n /** Synchronous cache of the items to manage. */\n this._items = [];\n this._typeaheadSubscription = Subscription.EMPTY;\n this._hasInitialFocused = false;\n /** Stream that emits any time the focused item changes. */\n this.change = new Subject();\n // We allow for the items to be an array or Observable because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (items instanceof QueryList) {\n this._items = items.toArray();\n items.changes.subscribe((newItems) => {\n this._items = newItems.toArray();\n this._typeahead?.setItems(this._items);\n this._updateActiveItemIndex(this._items);\n this._initializeFocus();\n });\n }\n else if (isObservable(items)) {\n items.subscribe(newItems => {\n this._items = newItems;\n this._typeahead?.setItems(newItems);\n this._updateActiveItemIndex(newItems);\n this._initializeFocus();\n });\n }\n else {\n this._items = items;\n this._initializeFocus();\n }\n if (typeof config.shouldActivationFollowFocus === 'boolean') {\n this._shouldActivationFollowFocus = config.shouldActivationFollowFocus;\n }\n if (config.horizontalOrientation) {\n this._horizontalOrientation = config.horizontalOrientation;\n }\n if (config.skipPredicate) {\n this._skipPredicateFn = config.skipPredicate;\n }\n if (config.trackBy) {\n this._trackByFn = config.trackBy;\n }\n if (typeof config.typeAheadDebounceInterval !== 'undefined') {\n this._setTypeAhead(config.typeAheadDebounceInterval);\n }\n }\n /** Cleans up the key manager. */\n destroy() {\n this._typeaheadSubscription.unsubscribe();\n this._typeahead?.destroy();\n this.change.complete();\n }\n /**\n * Handles a keyboard event on the tree.\n * @param event Keyboard event that represents the user interaction with the tree.\n */\n onKeydown(event) {\n const key = event.key;\n switch (key) {\n case 'Tab':\n // Return early here, in order to allow Tab to actually tab out of the tree\n return;\n case 'ArrowDown':\n this._focusNextItem();\n break;\n case 'ArrowUp':\n this._focusPreviousItem();\n break;\n case 'ArrowRight':\n this._horizontalOrientation === 'rtl'\n ? this._collapseCurrentItem()\n : this._expandCurrentItem();\n break;\n case 'ArrowLeft':\n this._horizontalOrientation === 'rtl'\n ? this._expandCurrentItem()\n : this._collapseCurrentItem();\n break;\n case 'Home':\n this._focusFirstItem();\n break;\n case 'End':\n this._focusLastItem();\n break;\n case 'Enter':\n case ' ':\n this._activateCurrentItem();\n break;\n default:\n if (event.key === '*') {\n this._expandAllItemsAtCurrentItemLevel();\n break;\n }\n this._typeahead?.handleKey(event);\n // Return here, in order to avoid preventing the default action of non-navigational\n // keys or resetting the buffer of pressed letters.\n return;\n }\n // Reset the typeahead since the user has used a navigational key.\n this._typeahead?.reset();\n event.preventDefault();\n }\n /** Index of the currently active item. */\n getActiveItemIndex() {\n return this._activeItemIndex;\n }\n /** The currently active item. */\n getActiveItem() {\n return this._activeItem;\n }\n /** Focus the first available item. */\n _focusFirstItem() {\n this.focusItem(this._findNextAvailableItemIndex(-1));\n }\n /** Focus the last available item. */\n _focusLastItem() {\n this.focusItem(this._findPreviousAvailableItemIndex(this._items.length));\n }\n /** Focus the next available item. */\n _focusNextItem() {\n this.focusItem(this._findNextAvailableItemIndex(this._activeItemIndex));\n }\n /** Focus the previous available item. */\n _focusPreviousItem() {\n this.focusItem(this._findPreviousAvailableItemIndex(this._activeItemIndex));\n }\n focusItem(itemOrIndex, options = {}) {\n // Set default options\n options.emitChangeEvent ??= true;\n let index = typeof itemOrIndex === 'number'\n ? itemOrIndex\n : this._items.findIndex(item => this._trackByFn(item) === this._trackByFn(itemOrIndex));\n if (index < 0 || index >= this._items.length) {\n return;\n }\n const activeItem = this._items[index];\n // If we're just setting the same item, don't re-call activate or focus\n if (this._activeItem !== null &&\n this._trackByFn(activeItem) === this._trackByFn(this._activeItem)) {\n return;\n }\n const previousActiveItem = this._activeItem;\n this._activeItem = activeItem ?? null;\n this._activeItemIndex = index;\n this._typeahead?.setCurrentSelectedItemIndex(index);\n this._activeItem?.focus();\n previousActiveItem?.unfocus();\n if (options.emitChangeEvent) {\n this.change.next(this._activeItem);\n }\n if (this._shouldActivationFollowFocus) {\n this._activateCurrentItem();\n }\n }\n _updateActiveItemIndex(newItems) {\n const activeItem = this._activeItem;\n if (!activeItem) {\n return;\n }\n const newIndex = newItems.findIndex(item => this._trackByFn(item) === this._trackByFn(activeItem));\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n this._typeahead?.setCurrentSelectedItemIndex(newIndex);\n }\n }\n _setTypeAhead(debounceInterval) {\n this._typeahead = new Typeahead(this._items, {\n debounceInterval: typeof debounceInterval === 'number' ? debounceInterval : undefined,\n skipPredicate: item => this._skipPredicateFn(item),\n });\n this._typeaheadSubscription = this._typeahead.selectedItem.subscribe(item => {\n this.focusItem(item);\n });\n }\n _findNextAvailableItemIndex(startingIndex) {\n for (let i = startingIndex + 1; i < this._items.length; i++) {\n if (!this._skipPredicateFn(this._items[i])) {\n return i;\n }\n }\n return startingIndex;\n }\n _findPreviousAvailableItemIndex(startingIndex) {\n for (let i = startingIndex - 1; i >= 0; i--) {\n if (!this._skipPredicateFn(this._items[i])) {\n return i;\n }\n }\n return startingIndex;\n }\n /**\n * If the item is already expanded, we collapse the item. Otherwise, we will focus the parent.\n */\n _collapseCurrentItem() {\n if (!this._activeItem) {\n return;\n }\n if (this._isCurrentItemExpanded()) {\n this._activeItem.collapse();\n }\n else {\n const parent = this._activeItem.getParent();\n if (!parent || this._skipPredicateFn(parent)) {\n return;\n }\n this.focusItem(parent);\n }\n }\n /**\n * If the item is already collapsed, we expand the item. Otherwise, we will focus the first child.\n */\n _expandCurrentItem() {\n if (!this._activeItem) {\n return;\n }\n if (!this._isCurrentItemExpanded()) {\n this._activeItem.expand();\n }\n else {\n coerceObservable(this._activeItem.getChildren())\n .pipe(take(1))\n .subscribe(children => {\n const firstChild = children.find(child => !this._skipPredicateFn(child));\n if (!firstChild) {\n return;\n }\n this.focusItem(firstChild);\n });\n }\n }\n _isCurrentItemExpanded() {\n if (!this._activeItem) {\n return false;\n }\n return typeof this._activeItem.isExpanded === 'boolean'\n ? this._activeItem.isExpanded\n : this._activeItem.isExpanded();\n }\n _isItemDisabled(item) {\n return typeof item.isDisabled === 'boolean' ? item.isDisabled : item.isDisabled?.();\n }\n /** For all items that are the same level as the current item, we expand those items. */\n _expandAllItemsAtCurrentItemLevel() {\n if (!this._activeItem) {\n return;\n }\n const parent = this._activeItem.getParent();\n let itemsToExpand;\n if (!parent) {\n itemsToExpand = of(this._items.filter(item => item.getParent() === null));\n }\n else {\n itemsToExpand = coerceObservable(parent.getChildren());\n }\n itemsToExpand.pipe(take(1)).subscribe(items => {\n for (const item of items) {\n item.expand();\n }\n });\n }\n _activateCurrentItem() {\n this._activeItem?.activate();\n }\n}\n/** @docs-private */\nfunction TREE_KEY_MANAGER_FACTORY() {\n return (items, options) => new TreeKeyManager(items, options);\n}\n/** Injection token that determines the key manager to use. */\nconst TREE_KEY_MANAGER = new InjectionToken('tree-key-manager', {\n providedIn: 'root',\n factory: TREE_KEY_MANAGER_FACTORY,\n});\n/** @docs-private */\nconst TREE_KEY_MANAGER_FACTORY_PROVIDER = {\n provide: TREE_KEY_MANAGER,\n useFactory: TREE_KEY_MANAGER_FACTORY,\n};\n\n// NoopTreeKeyManager is a \"noop\" implementation of TreeKeyMangerStrategy. Methods are noops. Does\n// not emit to streams.\n//\n// Used for applications built before TreeKeyManager to opt-out of TreeKeyManager and revert to\n// legacy behavior.\n/**\n * @docs-private\n *\n * Opt-out of Tree of key manager behavior.\n *\n * When provided, Tree has same focus management behavior as before TreeKeyManager was introduced.\n * - Tree does not respond to keyboard interaction\n * - Tree node allows tabindex to be set by Input binding\n * - Tree node allows tabindex to be set by attribute binding\n *\n * @deprecated NoopTreeKeyManager deprecated. Use TreeKeyManager or inject a\n * TreeKeyManagerStrategy instead. To be removed in a future version.\n *\n * @breaking-change 21.0.0\n */\nclass NoopTreeKeyManager {\n constructor() {\n this._isNoopTreeKeyManager = true;\n // Provide change as required by TreeKeyManagerStrategy. NoopTreeKeyManager is a \"noop\"\n // implementation that does not emit to streams.\n this.change = new Subject();\n }\n destroy() {\n this.change.complete();\n }\n onKeydown() {\n // noop\n }\n getActiveItemIndex() {\n // Always return null. NoopTreeKeyManager is a \"noop\" implementation that does not maintain\n // the active item.\n return null;\n }\n getActiveItem() {\n // Always return null. NoopTreeKeyManager is a \"noop\" implementation that does not maintain\n // the active item.\n return null;\n }\n focusItem() {\n // noop\n }\n}\n/**\n * @docs-private\n *\n * Opt-out of Tree of key manager behavior.\n *\n * When provided, Tree has same focus management behavior as before TreeKeyManager was introduced.\n * - Tree does not respond to keyboard interaction\n * - Tree node allows tabindex to be set by Input binding\n * - Tree node allows tabindex to be set by attribute binding\n *\n * @deprecated NoopTreeKeyManager deprecated. Use TreeKeyManager or inject a\n * TreeKeyManagerStrategy instead. To be removed in a future version.\n *\n * @breaking-change 21.0.0\n */\nfunction NOOP_TREE_KEY_MANAGER_FACTORY() {\n return () => new NoopTreeKeyManager();\n}\n/**\n * @docs-private\n *\n * Opt-out of Tree of key manager behavior.\n *\n * When provided, Tree has same focus management behavior as before TreeKeyManager was introduced.\n * - Tree does not respond to keyboard interaction\n * - Tree node allows tabindex to be set by Input binding\n * - Tree node allows tabindex to be set by attribute binding\n *\n * @deprecated NoopTreeKeyManager deprecated. Use TreeKeyManager or inject a\n * TreeKeyManagerStrategy instead. To be removed in a future version.\n *\n * @breaking-change 21.0.0\n */\nconst NOOP_TREE_KEY_MANAGER_FACTORY_PROVIDER = {\n provide: TREE_KEY_MANAGER,\n useFactory: NOOP_TREE_KEY_MANAGER_FACTORY,\n};\n\n/**\n * Configuration for the isFocusable method.\n */\nclass IsFocusableConfig {\n constructor() {\n /**\n * Whether to count an element as focusable even if it is not currently visible.\n */\n this.ignoreVisibility = false;\n }\n}\n// The InteractivityChecker leans heavily on the ally.js accessibility utilities.\n// Methods like `isTabbable` are only covering specific edge-cases for the browsers which are\n// supported.\n/**\n * Utility for checking the interactivity of an element, such as whether it is focusable or\n * tabbable.\n */\nclass InteractivityChecker {\n constructor(_platform) {\n this._platform = _platform;\n }\n /**\n * Gets whether an element is disabled.\n *\n * @param element Element to be checked.\n * @returns Whether the element is disabled.\n */\n isDisabled(element) {\n // This does not capture some cases, such as a non-form control with a disabled attribute or\n // a form control inside of a disabled form, but should capture the most common cases.\n return element.hasAttribute('disabled');\n }\n /**\n * Gets whether an element is visible for the purposes of interactivity.\n *\n * This will capture states like `display: none` and `visibility: hidden`, but not things like\n * being clipped by an `overflow: hidden` parent or being outside the viewport.\n *\n * @returns Whether the element is visible.\n */\n isVisible(element) {\n return hasGeometry(element) && getComputedStyle(element).visibility === 'visible';\n }\n /**\n * Gets whether an element can be reached via Tab key.\n * Assumes that the element has already been checked with isFocusable.\n *\n * @param element Element to be checked.\n * @returns Whether the element is tabbable.\n */\n isTabbable(element) {\n // Nothing is tabbable on the server 😎\n if (!this._platform.isBrowser) {\n return false;\n }\n const frameElement = getFrameElement(getWindow(element));\n if (frameElement) {\n // Frame elements inherit their tabindex onto all child elements.\n if (getTabIndexValue(frameElement) === -1) {\n return false;\n }\n // Browsers disable tabbing to an element inside of an invisible frame.\n if (!this.isVisible(frameElement)) {\n return false;\n }\n }\n let nodeName = element.nodeName.toLowerCase();\n let tabIndexValue = getTabIndexValue(element);\n if (element.hasAttribute('contenteditable')) {\n return tabIndexValue !== -1;\n }\n if (nodeName === 'iframe' || nodeName === 'object') {\n // The frame or object's content may be tabbable depending on the content, but it's\n // not possibly to reliably detect the content of the frames. We always consider such\n // elements as non-tabbable.\n return false;\n }\n // In iOS, the browser only considers some specific elements as tabbable.\n if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) {\n return false;\n }\n if (nodeName === 'audio') {\n // Audio elements without controls enabled are never tabbable, regardless\n // of the tabindex attribute explicitly being set.\n if (!element.hasAttribute('controls')) {\n return false;\n }\n // Audio elements with controls are by default tabbable unless the\n // tabindex attribute is set to `-1` explicitly.\n return tabIndexValue !== -1;\n }\n if (nodeName === 'video') {\n // For all video elements, if the tabindex attribute is set to `-1`, the video\n // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex`\n // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The\n // tabindex attribute is the source of truth here.\n if (tabIndexValue === -1) {\n return false;\n }\n // If the tabindex is explicitly set, and not `-1` (as per check before), the\n // video element is always tabbable (regardless of whether it has controls or not).\n if (tabIndexValue !== null) {\n return true;\n }\n // Otherwise (when no explicit tabindex is set), a video is only tabbable if it\n // has controls enabled. Firefox is special as videos are always tabbable regardless\n // of whether there are controls or not.\n return this._platform.FIREFOX || element.hasAttribute('controls');\n }\n return element.tabIndex >= 0;\n }\n /**\n * Gets whether an element can be focused by the user.\n *\n * @param element Element to be checked.\n * @param config The config object with options to customize this method's behavior\n * @returns Whether the element is focusable.\n */\n isFocusable(element, config) {\n // Perform checks in order of left to most expensive.\n // Again, naive approach that does not capture many edge cases and browser quirks.\n return (isPotentiallyFocusable(element) &&\n !this.isDisabled(element) &&\n (config?.ignoreVisibility || this.isVisible(element)));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InteractivityChecker, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InteractivityChecker, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InteractivityChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }] });\n/**\n * Returns the frame element from a window object. Since browsers like MS Edge throw errors if\n * the frameElement property is being accessed from a different host address, this property\n * should be accessed carefully.\n */\nfunction getFrameElement(window) {\n try {\n return window.frameElement;\n }\n catch {\n return null;\n }\n}\n/** Checks whether the specified element has any geometry / rectangles. */\nfunction hasGeometry(element) {\n // Use logic from jQuery to check for an invisible element.\n // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12\n return !!(element.offsetWidth ||\n element.offsetHeight ||\n (typeof element.getClientRects === 'function' && element.getClientRects().length));\n}\n/** Gets whether an element's */\nfunction isNativeFormElement(element) {\n let nodeName = element.nodeName.toLowerCase();\n return (nodeName === 'input' ||\n nodeName === 'select' ||\n nodeName === 'button' ||\n nodeName === 'textarea');\n}\n/** Gets whether an element is an ``. */\nfunction isHiddenInput(element) {\n return isInputElement(element) && element.type == 'hidden';\n}\n/** Gets whether an element is an anchor that has an href attribute. */\nfunction isAnchorWithHref(element) {\n return isAnchorElement(element) && element.hasAttribute('href');\n}\n/** Gets whether an element is an input element. */\nfunction isInputElement(element) {\n return element.nodeName.toLowerCase() == 'input';\n}\n/** Gets whether an element is an anchor element. */\nfunction isAnchorElement(element) {\n return element.nodeName.toLowerCase() == 'a';\n}\n/** Gets whether an element has a valid tabindex. */\nfunction hasValidTabIndex(element) {\n if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) {\n return false;\n }\n let tabIndex = element.getAttribute('tabindex');\n return !!(tabIndex && !isNaN(parseInt(tabIndex, 10)));\n}\n/**\n * Returns the parsed tabindex from the element attributes instead of returning the\n * evaluated tabindex from the browsers defaults.\n */\nfunction getTabIndexValue(element) {\n if (!hasValidTabIndex(element)) {\n return null;\n }\n // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054\n const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10);\n return isNaN(tabIndex) ? -1 : tabIndex;\n}\n/** Checks whether the specified element is potentially tabbable on iOS */\nfunction isPotentiallyTabbableIOS(element) {\n let nodeName = element.nodeName.toLowerCase();\n let inputType = nodeName === 'input' && element.type;\n return (inputType === 'text' ||\n inputType === 'password' ||\n nodeName === 'select' ||\n nodeName === 'textarea');\n}\n/**\n * Gets whether an element is potentially focusable without taking current visible/disabled state\n * into account.\n */\nfunction isPotentiallyFocusable(element) {\n // Inputs are potentially focusable *unless* they're type=\"hidden\".\n if (isHiddenInput(element)) {\n return false;\n }\n return (isNativeFormElement(element) ||\n isAnchorWithHref(element) ||\n element.hasAttribute('contenteditable') ||\n hasValidTabIndex(element));\n}\n/** Gets the parent window of a DOM node with regards of being inside of an iframe. */\nfunction getWindow(node) {\n // ownerDocument is null if `node` itself *is* a document.\n return (node.ownerDocument && node.ownerDocument.defaultView) || window;\n}\n\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class currently uses a relatively simple approach to focus trapping.\n * It assumes that the tab order is the same as DOM order, which is not necessarily true.\n * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to be misaligned.\n */\nclass FocusTrap {\n /** Whether the focus trap is active. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(value, this._startAnchor);\n this._toggleAnchorTabIndex(value, this._endAnchor);\n }\n }\n constructor(_element, _checker, _ngZone, _document, deferAnchors = false, \n /** @breaking-change 20.0.0 param to become required */\n _injector) {\n this._element = _element;\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n this._injector = _injector;\n this._hasAttached = false;\n // Event listeners for the anchors. Need to be regular functions so that we can unbind them later.\n this.startAnchorListener = () => this.focusLastTabbableElement();\n this.endAnchorListener = () => this.focusFirstTabbableElement();\n this._enabled = true;\n if (!deferAnchors) {\n this.attachAnchors();\n }\n }\n /** Destroys the focus trap by cleaning up the anchors. */\n destroy() {\n const startAnchor = this._startAnchor;\n const endAnchor = this._endAnchor;\n if (startAnchor) {\n startAnchor.removeEventListener('focus', this.startAnchorListener);\n startAnchor.remove();\n }\n if (endAnchor) {\n endAnchor.removeEventListener('focus', this.endAnchorListener);\n endAnchor.remove();\n }\n this._startAnchor = this._endAnchor = null;\n this._hasAttached = false;\n }\n /**\n * Inserts the anchors into the DOM. This is usually done automatically\n * in the constructor, but can be deferred for cases like directives with `*ngIf`.\n * @returns Whether the focus trap managed to attach successfully. This may not be the case\n * if the target element isn't currently in the DOM.\n */\n attachAnchors() {\n // If we're not on the browser, there can be no focus to trap.\n if (this._hasAttached) {\n return true;\n }\n this._ngZone.runOutsideAngular(() => {\n if (!this._startAnchor) {\n this._startAnchor = this._createAnchor();\n this._startAnchor.addEventListener('focus', this.startAnchorListener);\n }\n if (!this._endAnchor) {\n this._endAnchor = this._createAnchor();\n this._endAnchor.addEventListener('focus', this.endAnchorListener);\n }\n });\n if (this._element.parentNode) {\n this._element.parentNode.insertBefore(this._startAnchor, this._element);\n this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling);\n this._hasAttached = true;\n }\n return this._hasAttached;\n }\n /**\n * Waits for the zone to stabilize, then focuses the first tabbable element.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusInitialElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusInitialElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the first tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusFirstTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusFirstTabbableElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the last tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusLastTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusLastTabbableElement(options)));\n });\n }\n /**\n * Get the specified boundary element of the trapped region.\n * @param bound The boundary to get (start or end of trapped region).\n * @returns The boundary element.\n */\n _getRegionBoundary(bound) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` + `[cdkFocusRegion${bound}], ` + `[cdk-focus-${bound}]`);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n for (let i = 0; i < markers.length; i++) {\n // @breaking-change 8.0.0\n if (markers[i].hasAttribute(`cdk-focus-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated ` +\n `attribute will be removed in 8.0.0.`, markers[i]);\n }\n else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` +\n `will be removed in 8.0.0.`, markers[i]);\n }\n }\n }\n if (bound == 'start') {\n return markers.length ? markers[0] : this._getFirstTabbableElement(this._element);\n }\n return markers.length\n ? markers[markers.length - 1]\n : this._getLastTabbableElement(this._element);\n }\n /**\n * Focuses the element that should be focused when the focus trap is initialized.\n * @returns Whether focus was moved successfully.\n */\n focusInitialElement(options) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` + `[cdkFocusInitial]`);\n if (redirectToElement) {\n // @breaking-change 8.0.0\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n redirectToElement.hasAttribute(`cdk-focus-initial`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` +\n `use 'cdkFocusInitial' instead. The deprecated attribute ` +\n `will be removed in 8.0.0`, redirectToElement);\n }\n // Warn the consumer if the element they've pointed to\n // isn't focusable, when not in production mode.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !this._checker.isFocusable(redirectToElement)) {\n console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement);\n }\n if (!this._checker.isFocusable(redirectToElement)) {\n const focusableChild = this._getFirstTabbableElement(redirectToElement);\n focusableChild?.focus(options);\n return !!focusableChild;\n }\n redirectToElement.focus(options);\n return true;\n }\n return this.focusFirstTabbableElement(options);\n }\n /**\n * Focuses the first tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusFirstTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('start');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Focuses the last tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusLastTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('end');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Checks whether the focus trap has successfully been attached.\n */\n hasAttached() {\n return this._hasAttached;\n }\n /** Get the first tabbable element from a DOM subtree (inclusive). */\n _getFirstTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n const children = root.children;\n for (let i = 0; i < children.length; i++) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getFirstTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Get the last tabbable element from a DOM subtree (inclusive). */\n _getLastTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in reverse DOM order.\n const children = root.children;\n for (let i = children.length - 1; i >= 0; i--) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getLastTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Creates an anchor element. */\n _createAnchor() {\n const anchor = this._document.createElement('div');\n this._toggleAnchorTabIndex(this._enabled, anchor);\n anchor.classList.add('cdk-visually-hidden');\n anchor.classList.add('cdk-focus-trap-anchor');\n anchor.setAttribute('aria-hidden', 'true');\n return anchor;\n }\n /**\n * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap.\n * @param isEnabled Whether the focus trap is enabled.\n * @param anchor Anchor on which to toggle the tabindex.\n */\n _toggleAnchorTabIndex(isEnabled, anchor) {\n // Remove the tabindex completely, rather than setting it to -1, because if the\n // element has a tabindex, the user might still hit it when navigating with the arrow keys.\n isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex');\n }\n /**\n * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape.\n * @param enabled: Whether the anchors should trap Tab.\n */\n toggleAnchors(enabled) {\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(enabled, this._startAnchor);\n this._toggleAnchorTabIndex(enabled, this._endAnchor);\n }\n }\n /** Executes a function when the zone is stable. */\n _executeOnStable(fn) {\n // TODO: remove this conditional when injector is required in the constructor.\n if (this._injector) {\n afterNextRender(fn, { injector: this._injector });\n }\n else {\n setTimeout(fn);\n }\n }\n}\n/**\n * Factory that allows easy instantiation of focus traps.\n */\nclass FocusTrapFactory {\n constructor(_checker, _ngZone, _document) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._injector = inject(Injector);\n this._document = _document;\n }\n /**\n * Creates a focus-trapped region around the given element.\n * @param element The element around which focus will be trapped.\n * @param deferCaptureElements Defers the creation of focus-capturing elements to be done\n * manually by the user.\n * @returns The created focus trap instance.\n */\n create(element, deferCaptureElements = false) {\n return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements, this._injector);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapFactory, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n/** Directive for trapping focus within a region. */\nclass CdkTrapFocus {\n /** Whether the focus trap is active. */\n get enabled() {\n return this.focusTrap?.enabled || false;\n }\n set enabled(value) {\n if (this.focusTrap) {\n this.focusTrap.enabled = value;\n }\n }\n constructor(_elementRef, _focusTrapFactory, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 13.0.0\n */\n _document) {\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n /** Previously focused element to restore focus to upon destroy when using autoCapture. */\n this._previouslyFocusedElement = null;\n const platform = inject(Platform);\n if (platform.isBrowser) {\n this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true);\n }\n }\n ngOnDestroy() {\n this.focusTrap?.destroy();\n // If we stored a previously focused element when using autoCapture, return focus to that\n // element now that the trapped region is being destroyed.\n if (this._previouslyFocusedElement) {\n this._previouslyFocusedElement.focus();\n this._previouslyFocusedElement = null;\n }\n }\n ngAfterContentInit() {\n this.focusTrap?.attachAnchors();\n if (this.autoCapture) {\n this._captureFocus();\n }\n }\n ngDoCheck() {\n if (this.focusTrap && !this.focusTrap.hasAttached()) {\n this.focusTrap.attachAnchors();\n }\n }\n ngOnChanges(changes) {\n const autoCaptureChange = changes['autoCapture'];\n if (autoCaptureChange &&\n !autoCaptureChange.firstChange &&\n this.autoCapture &&\n this.focusTrap?.hasAttached()) {\n this._captureFocus();\n }\n }\n _captureFocus() {\n this._previouslyFocusedElement = _getFocusedElementPierceShadowDom();\n this.focusTrap?.focusInitialElementWhenReady();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTrapFocus, deps: [{ token: i0.ElementRef }, { token: FocusTrapFactory }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkTrapFocus, isStandalone: true, selector: \"[cdkTrapFocus]\", inputs: { enabled: [\"cdkTrapFocus\", \"enabled\", booleanAttribute], autoCapture: [\"cdkTrapFocusAutoCapture\", \"autoCapture\", booleanAttribute] }, exportAs: [\"cdkTrapFocus\"], usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTrapFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTrapFocus]',\n exportAs: 'cdkTrapFocus',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: FocusTrapFactory }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }], propDecorators: { enabled: [{\n type: Input,\n args: [{ alias: 'cdkTrapFocus', transform: booleanAttribute }]\n }], autoCapture: [{\n type: Input,\n args: [{ alias: 'cdkTrapFocusAutoCapture', transform: booleanAttribute }]\n }] } });\n\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class uses a strategy pattern that determines how it traps focus.\n * See FocusTrapInertStrategy.\n */\nclass ConfigurableFocusTrap extends FocusTrap {\n /** Whether the FocusTrap is enabled. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._enabled) {\n this._focusTrapManager.register(this);\n }\n else {\n this._focusTrapManager.deregister(this);\n }\n }\n constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config, injector) {\n super(_element, _checker, _ngZone, _document, config.defer, injector);\n this._focusTrapManager = _focusTrapManager;\n this._inertStrategy = _inertStrategy;\n this._focusTrapManager.register(this);\n }\n /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */\n destroy() {\n this._focusTrapManager.deregister(this);\n super.destroy();\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _enable() {\n this._inertStrategy.preventFocus(this);\n this.toggleAnchors(true);\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _disable() {\n this._inertStrategy.allowFocus(this);\n this.toggleAnchors(false);\n }\n}\n\n/**\n * Lightweight FocusTrapInertStrategy that adds a document focus event\n * listener to redirect focus back inside the FocusTrap.\n */\nclass EventListenerFocusTrapInertStrategy {\n constructor() {\n /** Focus event handler. */\n this._listener = null;\n }\n /** Adds a document event listener that keeps focus inside the FocusTrap. */\n preventFocus(focusTrap) {\n // Ensure there's only one listener per document\n if (this._listener) {\n focusTrap._document.removeEventListener('focus', this._listener, true);\n }\n this._listener = (e) => this._trapFocus(focusTrap, e);\n focusTrap._ngZone.runOutsideAngular(() => {\n focusTrap._document.addEventListener('focus', this._listener, true);\n });\n }\n /** Removes the event listener added in preventFocus. */\n allowFocus(focusTrap) {\n if (!this._listener) {\n return;\n }\n focusTrap._document.removeEventListener('focus', this._listener, true);\n this._listener = null;\n }\n /**\n * Refocuses the first element in the FocusTrap if the focus event target was outside\n * the FocusTrap.\n *\n * This is an event listener callback. The event listener is added in runOutsideAngular,\n * so all this code runs outside Angular as well.\n */\n _trapFocus(focusTrap, event) {\n const target = event.target;\n const focusTrapRoot = focusTrap._element;\n // Don't refocus if target was in an overlay, because the overlay might be associated\n // with an element inside the FocusTrap, ex. mat-select.\n if (target && !focusTrapRoot.contains(target) && !target.closest?.('div.cdk-overlay-pane')) {\n // Some legacy FocusTrap usages have logic that focuses some element on the page\n // just before FocusTrap is destroyed. For backwards compatibility, wait\n // to be sure FocusTrap is still enabled before refocusing.\n setTimeout(() => {\n // Check whether focus wasn't put back into the focus trap while the timeout was pending.\n if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) {\n focusTrap.focusFirstTabbableElement();\n }\n });\n }\n }\n}\n\n/** The injection token used to specify the inert strategy. */\nconst FOCUS_TRAP_INERT_STRATEGY = new InjectionToken('FOCUS_TRAP_INERT_STRATEGY');\n\n/** Injectable that ensures only the most recently enabled FocusTrap is active. */\nclass FocusTrapManager {\n constructor() {\n // A stack of the FocusTraps on the page. Only the FocusTrap at the\n // top of the stack is active.\n this._focusTrapStack = [];\n }\n /**\n * Disables the FocusTrap at the top of the stack, and then pushes\n * the new FocusTrap onto the stack.\n */\n register(focusTrap) {\n // Dedupe focusTraps that register multiple times.\n this._focusTrapStack = this._focusTrapStack.filter(ft => ft !== focusTrap);\n let stack = this._focusTrapStack;\n if (stack.length) {\n stack[stack.length - 1]._disable();\n }\n stack.push(focusTrap);\n focusTrap._enable();\n }\n /**\n * Removes the FocusTrap from the stack, and activates the\n * FocusTrap that is the new top of the stack.\n */\n deregister(focusTrap) {\n focusTrap._disable();\n const stack = this._focusTrapStack;\n const i = stack.indexOf(focusTrap);\n if (i !== -1) {\n stack.splice(i, 1);\n if (stack.length) {\n stack[stack.length - 1]._enable();\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapManager, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapManager, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusTrapManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/** Factory that allows easy instantiation of configurable focus traps. */\nclass ConfigurableFocusTrapFactory {\n constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._focusTrapManager = _focusTrapManager;\n this._injector = inject(Injector);\n this._document = _document;\n // TODO split up the strategies into different modules, similar to DateAdapter.\n this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy();\n }\n create(element, config = { defer: false }) {\n let configObject;\n if (typeof config === 'boolean') {\n configObject = { defer: config };\n }\n else {\n configObject = config;\n }\n return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject, this._injector);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ConfigurableFocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: FocusTrapManager }, { token: DOCUMENT }, { token: FOCUS_TRAP_INERT_STRATEGY, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ConfigurableFocusTrapFactory, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ConfigurableFocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: FocusTrapManager }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_TRAP_INERT_STRATEGY]\n }] }] });\n\n/** Gets whether an event could be a faked `mousedown` event dispatched by a screen reader. */\nfunction isFakeMousedownFromScreenReader(event) {\n // Some screen readers will dispatch a fake `mousedown` event when pressing enter or space on\n // a clickable element. We can distinguish these events when `event.buttons` is zero, or\n // `event.detail` is zero depending on the browser:\n // - `event.buttons` works on Firefox, but fails on Chrome.\n // - `detail` works on Chrome, but fails on Firefox.\n return event.buttons === 0 || event.detail === 0;\n}\n/** Gets whether an event could be a faked `touchstart` event dispatched by a screen reader. */\nfunction isFakeTouchstartFromScreenReader(event) {\n const touch = (event.touches && event.touches[0]) || (event.changedTouches && event.changedTouches[0]);\n // A fake `touchstart` can be distinguished from a real one by looking at the `identifier`\n // which is typically >= 0 on a real device versus -1 from a screen reader. Just to be safe,\n // we can also look at `radiusX` and `radiusY`. This behavior was observed against a Windows 10\n // device with a touch screen running NVDA v2020.4 and Firefox 85 or Chrome 88.\n return (!!touch &&\n touch.identifier === -1 &&\n (touch.radiusX == null || touch.radiusX === 1) &&\n (touch.radiusY == null || touch.radiusY === 1));\n}\n\n/**\n * Injectable options for the InputModalityDetector. These are shallowly merged with the default\n * options.\n */\nconst INPUT_MODALITY_DETECTOR_OPTIONS = new InjectionToken('cdk-input-modality-detector-options');\n/**\n * Default options for the InputModalityDetector.\n *\n * Modifier keys are ignored by default (i.e. when pressed won't cause the service to detect\n * keyboard input modality) for two reasons:\n *\n * 1. Modifier keys are commonly used with mouse to perform actions such as 'right click' or 'open\n * in new tab', and are thus less representative of actual keyboard interaction.\n * 2. VoiceOver triggers some keyboard events when linearly navigating with Control + Option (but\n * confusingly not with Caps Lock). Thus, to have parity with other screen readers, we ignore\n * these keys so as to not update the input modality.\n *\n * Note that we do not by default ignore the right Meta key on Safari because it has the same key\n * code as the ContextMenu key on other browsers. When we switch to using event.key, we can\n * distinguish between the two.\n */\nconst INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS = {\n ignoreKeys: [ALT, CONTROL, MAC_META, META, SHIFT],\n};\n/**\n * The amount of time needed to pass after a touchstart event in order for a subsequent mousedown\n * event to be attributed as mouse and not touch.\n *\n * This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found\n * that a value of around 650ms seems appropriate.\n */\nconst TOUCH_BUFFER_MS = 650;\n/**\n * Event listener options that enable capturing and also mark the listener as passive if the browser\n * supports it.\n */\nconst modalityEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/**\n * Service that detects the user's input modality.\n *\n * This service does not update the input modality when a user navigates with a screen reader\n * (e.g. linear navigation with VoiceOver, object navigation / browse mode with NVDA, virtual PC\n * cursor mode with JAWS). This is in part due to technical limitations (i.e. keyboard events do not\n * fire as expected in these modes) but is also arguably the correct behavior. Navigating with a\n * screen reader is akin to visually scanning a page, and should not be interpreted as actual user\n * input interaction.\n *\n * When a user is not navigating but *interacting* with a screen reader, this service attempts to\n * update the input modality to keyboard, but in general this service's behavior is largely\n * undefined.\n */\nclass InputModalityDetector {\n /** The most recently detected input modality. */\n get mostRecentModality() {\n return this._modality.value;\n }\n constructor(_platform, ngZone, document, options) {\n this._platform = _platform;\n /**\n * The most recently detected input modality event target. Is null if no input modality has been\n * detected or if the associated event target is null for some unknown reason.\n */\n this._mostRecentTarget = null;\n /** The underlying BehaviorSubject that emits whenever an input modality is detected. */\n this._modality = new BehaviorSubject(null);\n /**\n * The timestamp of the last touch input modality. Used to determine whether mousedown events\n * should be attributed to mouse or touch.\n */\n this._lastTouchMs = 0;\n /**\n * Handles keydown events. Must be an arrow function in order to preserve the context when it gets\n * bound.\n */\n this._onKeydown = (event) => {\n // If this is one of the keys we should ignore, then ignore it and don't update the input\n // modality to keyboard.\n if (this._options?.ignoreKeys?.some(keyCode => keyCode === event.keyCode)) {\n return;\n }\n this._modality.next('keyboard');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles mousedown events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onMousedown = (event) => {\n // Touches trigger both touch and mouse events, so we need to distinguish between mouse events\n // that were triggered via mouse vs touch. To do so, check if the mouse event occurs closely\n // after the previous touch event.\n if (Date.now() - this._lastTouchMs < TOUCH_BUFFER_MS) {\n return;\n }\n // Fake mousedown events are fired by some screen readers when controls are activated by the\n // screen reader. Attribute them to keyboard input modality.\n this._modality.next(isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles touchstart events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onTouchstart = (event) => {\n // Same scenario as mentioned in _onMousedown, but on touch screen devices, fake touchstart\n // events are fired. Again, attribute to keyboard input modality.\n if (isFakeTouchstartFromScreenReader(event)) {\n this._modality.next('keyboard');\n return;\n }\n // Store the timestamp of this touch event, as it's used to distinguish between mouse events\n // triggered via mouse vs touch.\n this._lastTouchMs = Date.now();\n this._modality.next('touch');\n this._mostRecentTarget = _getEventTarget(event);\n };\n this._options = {\n ...INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS,\n ...options,\n };\n // Skip the first emission as it's null.\n this.modalityDetected = this._modality.pipe(skip(1));\n this.modalityChanged = this.modalityDetected.pipe(distinctUntilChanged());\n // If we're not in a browser, this service should do nothing, as there's no relevant input\n // modality to detect.\n if (_platform.isBrowser) {\n ngZone.runOutsideAngular(() => {\n document.addEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.addEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.addEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n });\n }\n }\n ngOnDestroy() {\n this._modality.complete();\n if (this._platform.isBrowser) {\n document.removeEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.removeEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.removeEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InputModalityDetector, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT }, { token: INPUT_MODALITY_DETECTOR_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InputModalityDetector, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: InputModalityDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }, { type: i0.NgZone }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [INPUT_MODALITY_DETECTOR_OPTIONS]\n }] }] });\n\nconst LIVE_ANNOUNCER_ELEMENT_TOKEN = new InjectionToken('liveAnnouncerElement', {\n providedIn: 'root',\n factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY,\n});\n/** @docs-private */\nfunction LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() {\n return null;\n}\n/** Injection token that can be used to configure the default options for the LiveAnnouncer. */\nconst LIVE_ANNOUNCER_DEFAULT_OPTIONS = new InjectionToken('LIVE_ANNOUNCER_DEFAULT_OPTIONS');\n\nlet uniqueIds = 0;\nclass LiveAnnouncer {\n constructor(elementToken, _ngZone, _document, _defaultOptions) {\n this._ngZone = _ngZone;\n this._defaultOptions = _defaultOptions;\n // We inject the live element and document as `any` because the constructor signature cannot\n // reference browser globals (HTMLElement, Document) on non-browser environments, since having\n // a class decorator causes TypeScript to preserve the constructor signature types.\n this._document = _document;\n this._liveElement = elementToken || this._createLiveElement();\n }\n announce(message, ...args) {\n const defaultOptions = this._defaultOptions;\n let politeness;\n let duration;\n if (args.length === 1 && typeof args[0] === 'number') {\n duration = args[0];\n }\n else {\n [politeness, duration] = args;\n }\n this.clear();\n clearTimeout(this._previousTimeout);\n if (!politeness) {\n politeness =\n defaultOptions && defaultOptions.politeness ? defaultOptions.politeness : 'polite';\n }\n if (duration == null && defaultOptions) {\n duration = defaultOptions.duration;\n }\n // TODO: ensure changing the politeness works on all environments we support.\n this._liveElement.setAttribute('aria-live', politeness);\n if (this._liveElement.id) {\n this._exposeAnnouncerToModals(this._liveElement.id);\n }\n // This 100ms timeout is necessary for some browser + screen-reader combinations:\n // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout.\n // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a\n // second time without clearing and then using a non-zero delay.\n // (using JAWS 17 at time of this writing).\n return this._ngZone.runOutsideAngular(() => {\n if (!this._currentPromise) {\n this._currentPromise = new Promise(resolve => (this._currentResolve = resolve));\n }\n clearTimeout(this._previousTimeout);\n this._previousTimeout = setTimeout(() => {\n this._liveElement.textContent = message;\n if (typeof duration === 'number') {\n this._previousTimeout = setTimeout(() => this.clear(), duration);\n }\n // For some reason in tests this can be undefined\n // Probably related to ZoneJS and every other thing that patches browser APIs in tests\n this._currentResolve?.();\n this._currentPromise = this._currentResolve = undefined;\n }, 100);\n return this._currentPromise;\n });\n }\n /**\n * Clears the current text from the announcer element. Can be used to prevent\n * screen readers from reading the text out again while the user is going\n * through the page landmarks.\n */\n clear() {\n if (this._liveElement) {\n this._liveElement.textContent = '';\n }\n }\n ngOnDestroy() {\n clearTimeout(this._previousTimeout);\n this._liveElement?.remove();\n this._liveElement = null;\n this._currentResolve?.();\n this._currentPromise = this._currentResolve = undefined;\n }\n _createLiveElement() {\n const elementClass = 'cdk-live-announcer-element';\n const previousElements = this._document.getElementsByClassName(elementClass);\n const liveEl = this._document.createElement('div');\n // Remove any old containers. This can happen when coming in from a server-side-rendered page.\n for (let i = 0; i < previousElements.length; i++) {\n previousElements[i].remove();\n }\n liveEl.classList.add(elementClass);\n liveEl.classList.add('cdk-visually-hidden');\n liveEl.setAttribute('aria-atomic', 'true');\n liveEl.setAttribute('aria-live', 'polite');\n liveEl.id = `cdk-live-announcer-${uniqueIds++}`;\n this._document.body.appendChild(liveEl);\n return liveEl;\n }\n /**\n * Some browsers won't expose the accessibility node of the live announcer element if there is an\n * `aria-modal` and the live announcer is outside of it. This method works around the issue by\n * pointing the `aria-owns` of all modals to the live announcer element.\n */\n _exposeAnnouncerToModals(id) {\n // TODO(http://github.com/angular/components/issues/26853): consider de-duplicating this with\n // the `SnakBarContainer` and other usages.\n //\n // Note that the selector here is limited to CDK overlays at the moment in order to reduce the\n // section of the DOM we need to look through. This should cover all the cases we support, but\n // the selector can be expanded if it turns out to be too narrow.\n const modals = this._document.querySelectorAll('body > .cdk-overlay-container [aria-modal=\"true\"]');\n for (let i = 0; i < modals.length; i++) {\n const modal = modals[i];\n const ariaOwns = modal.getAttribute('aria-owns');\n if (!ariaOwns) {\n modal.setAttribute('aria-owns', id);\n }\n else if (ariaOwns.indexOf(id) === -1) {\n modal.setAttribute('aria-owns', ariaOwns + ' ' + id);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LiveAnnouncer, deps: [{ token: LIVE_ANNOUNCER_ELEMENT_TOKEN, optional: true }, { token: i0.NgZone }, { token: DOCUMENT }, { token: LIVE_ANNOUNCER_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LiveAnnouncer, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: LiveAnnouncer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_ELEMENT_TOKEN]\n }] }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS]\n }] }] });\n/**\n * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility\n * with a wider range of browsers and screen readers.\n */\nclass CdkAriaLive {\n /** The aria-live politeness level to use when announcing messages. */\n get politeness() {\n return this._politeness;\n }\n set politeness(value) {\n this._politeness = value === 'off' || value === 'assertive' ? value : 'polite';\n if (this._politeness === 'off') {\n if (this._subscription) {\n this._subscription.unsubscribe();\n this._subscription = null;\n }\n }\n else if (!this._subscription) {\n this._subscription = this._ngZone.runOutsideAngular(() => {\n return this._contentObserver.observe(this._elementRef).subscribe(() => {\n // Note that we use textContent here, rather than innerText, in order to avoid a reflow.\n const elementText = this._elementRef.nativeElement.textContent;\n // The `MutationObserver` fires also for attribute\n // changes which we don't want to announce.\n if (elementText !== this._previousAnnouncedText) {\n this._liveAnnouncer.announce(elementText, this._politeness, this.duration);\n this._previousAnnouncedText = elementText;\n }\n });\n });\n }\n }\n constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) {\n this._elementRef = _elementRef;\n this._liveAnnouncer = _liveAnnouncer;\n this._contentObserver = _contentObserver;\n this._ngZone = _ngZone;\n this._politeness = 'polite';\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._subscription.unsubscribe();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkAriaLive, deps: [{ token: i0.ElementRef }, { token: LiveAnnouncer }, { token: i1$1.ContentObserver }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkAriaLive, isStandalone: true, selector: \"[cdkAriaLive]\", inputs: { politeness: [\"cdkAriaLive\", \"politeness\"], duration: [\"cdkAriaLiveDuration\", \"duration\"] }, exportAs: [\"cdkAriaLive\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkAriaLive, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkAriaLive]',\n exportAs: 'cdkAriaLive',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: LiveAnnouncer }, { type: i1$1.ContentObserver }, { type: i0.NgZone }], propDecorators: { politeness: [{\n type: Input,\n args: ['cdkAriaLive']\n }], duration: [{\n type: Input,\n args: ['cdkAriaLiveDuration']\n }] } });\n\n/** Detection mode used for attributing the origin of a focus event. */\nvar FocusMonitorDetectionMode;\n(function (FocusMonitorDetectionMode) {\n /**\n * Any mousedown, keydown, or touchstart event that happened in the previous\n * tick or the current tick will be used to assign a focus event's origin (to\n * either mouse, keyboard, or touch). This is the default option.\n */\n FocusMonitorDetectionMode[FocusMonitorDetectionMode[\"IMMEDIATE\"] = 0] = \"IMMEDIATE\";\n /**\n * A focus event's origin is always attributed to the last corresponding\n * mousedown, keydown, or touchstart event, no matter how long ago it occurred.\n */\n FocusMonitorDetectionMode[FocusMonitorDetectionMode[\"EVENTUAL\"] = 1] = \"EVENTUAL\";\n})(FocusMonitorDetectionMode || (FocusMonitorDetectionMode = {}));\n/** InjectionToken for FocusMonitorOptions. */\nconst FOCUS_MONITOR_DEFAULT_OPTIONS = new InjectionToken('cdk-focus-monitor-default-options');\n/**\n * Event listener options that enable capturing and also\n * mark the listener as passive if the browser supports it.\n */\nconst captureEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/** Monitors mouse and keyboard events to determine the cause of focus events. */\nclass FocusMonitor {\n constructor(_ngZone, _platform, _inputModalityDetector, \n /** @breaking-change 11.0.0 make document required */\n document, options) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n this._inputModalityDetector = _inputModalityDetector;\n /** The focus origin that the next focus event is a result of. */\n this._origin = null;\n /** Whether the window has just been focused. */\n this._windowFocused = false;\n /**\n * Whether the origin was determined via a touch interaction. Necessary as properly attributing\n * focus events to touch interactions requires special logic.\n */\n this._originFromTouchInteraction = false;\n /** Map of elements being monitored to their info. */\n this._elementInfo = new Map();\n /** The number of elements currently being monitored. */\n this._monitoredElementCount = 0;\n /**\n * Keeps track of the root nodes to which we've currently bound a focus/blur handler,\n * as well as the number of monitored elements that they contain. We have to treat focus/blur\n * handlers differently from the rest of the events, because the browser won't emit events\n * to the document when focus moves inside of a shadow root.\n */\n this._rootNodeFocusListenerCount = new Map();\n /**\n * Event listener for `focus` events on the window.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._windowFocusListener = () => {\n // Make a note of when the window regains focus, so we can\n // restore the origin info for the focused element.\n this._windowFocused = true;\n this._windowFocusTimeoutId = window.setTimeout(() => (this._windowFocused = false));\n };\n /** Subject for stopping our InputModalityDetector subscription. */\n this._stopInputModalityDetector = new Subject();\n /**\n * Event listener for `focus` and 'blur' events on the document.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._rootNodeFocusAndBlurListener = (event) => {\n const target = _getEventTarget(event);\n // We need to walk up the ancestor chain in order to support `checkChildren`.\n for (let element = target; element; element = element.parentElement) {\n if (event.type === 'focus') {\n this._onFocus(event, element);\n }\n else {\n this._onBlur(event, element);\n }\n }\n };\n this._document = document;\n this._detectionMode = options?.detectionMode || FocusMonitorDetectionMode.IMMEDIATE;\n }\n monitor(element, checkChildren = false) {\n const nativeElement = coerceElement(element);\n // Do nothing if we're not on the browser platform or the passed in node isn't an element.\n if (!this._platform.isBrowser || nativeElement.nodeType !== 1) {\n // Note: we don't want the observable to emit at all so we don't pass any parameters.\n return of();\n }\n // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to\n // the shadow root, rather than the `document`, because the browser won't emit focus events\n // to the `document`, if focus is moving within the same shadow root.\n const rootNode = _getShadowRoot(nativeElement) || this._getDocument();\n const cachedInfo = this._elementInfo.get(nativeElement);\n // Check if we're already monitoring this element.\n if (cachedInfo) {\n if (checkChildren) {\n // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren\n // observers into ones that behave as if `checkChildren` was turned on. We need a more\n // robust solution.\n cachedInfo.checkChildren = true;\n }\n return cachedInfo.subject;\n }\n // Create monitored element info.\n const info = {\n checkChildren: checkChildren,\n subject: new Subject(),\n rootNode,\n };\n this._elementInfo.set(nativeElement, info);\n this._registerGlobalListeners(info);\n return info.subject;\n }\n stopMonitoring(element) {\n const nativeElement = coerceElement(element);\n const elementInfo = this._elementInfo.get(nativeElement);\n if (elementInfo) {\n elementInfo.subject.complete();\n this._setClasses(nativeElement);\n this._elementInfo.delete(nativeElement);\n this._removeGlobalListeners(elementInfo);\n }\n }\n focusVia(element, origin, options) {\n const nativeElement = coerceElement(element);\n const focusedElement = this._getDocument().activeElement;\n // If the element is focused already, calling `focus` again won't trigger the event listener\n // which means that the focus classes won't be updated. If that's the case, update the classes\n // directly without waiting for an event.\n if (nativeElement === focusedElement) {\n this._getClosestElementsInfo(nativeElement).forEach(([currentElement, info]) => this._originChanged(currentElement, origin, info));\n }\n else {\n this._setOrigin(origin);\n // `focus` isn't available on the server\n if (typeof nativeElement.focus === 'function') {\n nativeElement.focus(options);\n }\n }\n }\n ngOnDestroy() {\n this._elementInfo.forEach((_info, element) => this.stopMonitoring(element));\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n _getFocusOrigin(focusEventTarget) {\n if (this._origin) {\n // If the origin was realized via a touch interaction, we need to perform additional checks\n // to determine whether the focus origin should be attributed to touch or program.\n if (this._originFromTouchInteraction) {\n return this._shouldBeAttributedToTouch(focusEventTarget) ? 'touch' : 'program';\n }\n else {\n return this._origin;\n }\n }\n // If the window has just regained focus, we can restore the most recent origin from before the\n // window blurred. Otherwise, we've reached the point where we can't identify the source of the\n // focus. This typically means one of two things happened:\n //\n // 1) The element was programmatically focused, or\n // 2) The element was focused via screen reader navigation (which generally doesn't fire\n // events).\n //\n // Because we can't distinguish between these two cases, we default to setting `program`.\n if (this._windowFocused && this._lastFocusOrigin) {\n return this._lastFocusOrigin;\n }\n // If the interaction is coming from an input label, we consider it a mouse interactions.\n // This is a special case where focus moves on `click`, rather than `mousedown` which breaks\n // our detection, because all our assumptions are for `mousedown`. We need to handle this\n // special case, because it's very common for checkboxes and radio buttons.\n if (focusEventTarget && this._isLastInteractionFromInputLabel(focusEventTarget)) {\n return 'mouse';\n }\n return 'program';\n }\n /**\n * Returns whether the focus event should be attributed to touch. Recall that in IMMEDIATE mode, a\n * touch origin isn't immediately reset at the next tick (see _setOrigin). This means that when we\n * handle a focus event following a touch interaction, we need to determine whether (1) the focus\n * event was directly caused by the touch interaction or (2) the focus event was caused by a\n * subsequent programmatic focus call triggered by the touch interaction.\n * @param focusEventTarget The target of the focus event under examination.\n */\n _shouldBeAttributedToTouch(focusEventTarget) {\n // Please note that this check is not perfect. Consider the following edge case:\n //\n // \n // \n //
\n //\n // Suppose there is a FocusMonitor in IMMEDIATE mode attached to #parent. When the user touches\n // #child, #parent is programmatically focused. This code will attribute the focus to touch\n // instead of program. This is a relatively minor edge-case that can be worked around by using\n // focusVia(parent, 'program') to focus #parent.\n return (this._detectionMode === FocusMonitorDetectionMode.EVENTUAL ||\n !!focusEventTarget?.contains(this._inputModalityDetector._mostRecentTarget));\n }\n /**\n * Sets the focus classes on the element based on the given focus origin.\n * @param element The element to update the classes on.\n * @param origin The focus origin.\n */\n _setClasses(element, origin) {\n element.classList.toggle('cdk-focused', !!origin);\n element.classList.toggle('cdk-touch-focused', origin === 'touch');\n element.classList.toggle('cdk-keyboard-focused', origin === 'keyboard');\n element.classList.toggle('cdk-mouse-focused', origin === 'mouse');\n element.classList.toggle('cdk-program-focused', origin === 'program');\n }\n /**\n * Updates the focus origin. If we're using immediate detection mode, we schedule an async\n * function to clear the origin at the end of a timeout. The duration of the timeout depends on\n * the origin being set.\n * @param origin The origin to set.\n * @param isFromInteraction Whether we are setting the origin from an interaction event.\n */\n _setOrigin(origin, isFromInteraction = false) {\n this._ngZone.runOutsideAngular(() => {\n this._origin = origin;\n this._originFromTouchInteraction = origin === 'touch' && isFromInteraction;\n // If we're in IMMEDIATE mode, reset the origin at the next tick (or in `TOUCH_BUFFER_MS` ms\n // for a touch event). We reset the origin at the next tick because Firefox focuses one tick\n // after the interaction event. We wait `TOUCH_BUFFER_MS` ms before resetting the origin for\n // a touch event because when a touch event is fired, the associated focus event isn't yet in\n // the event queue. Before doing so, clear any pending timeouts.\n if (this._detectionMode === FocusMonitorDetectionMode.IMMEDIATE) {\n clearTimeout(this._originTimeoutId);\n const ms = this._originFromTouchInteraction ? TOUCH_BUFFER_MS : 1;\n this._originTimeoutId = setTimeout(() => (this._origin = null), ms);\n }\n });\n }\n /**\n * Handles focus events on a registered element.\n * @param event The focus event.\n * @param element The monitored element.\n */\n _onFocus(event, element) {\n // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent\n // focus event affecting the monitored element. If we want to use the origin of the first event\n // instead we should check for the cdk-focused class here and return if the element already has\n // it. (This only matters for elements that have includesChildren = true).\n // If we are not counting child-element-focus as focused, make sure that the event target is the\n // monitored element itself.\n const elementInfo = this._elementInfo.get(element);\n const focusEventTarget = _getEventTarget(event);\n if (!elementInfo || (!elementInfo.checkChildren && element !== focusEventTarget)) {\n return;\n }\n this._originChanged(element, this._getFocusOrigin(focusEventTarget), elementInfo);\n }\n /**\n * Handles blur events on a registered element.\n * @param event The blur event.\n * @param element The monitored element.\n */\n _onBlur(event, element) {\n // If we are counting child-element-focus as focused, make sure that we aren't just blurring in\n // order to focus another child of the monitored element.\n const elementInfo = this._elementInfo.get(element);\n if (!elementInfo ||\n (elementInfo.checkChildren &&\n event.relatedTarget instanceof Node &&\n element.contains(event.relatedTarget))) {\n return;\n }\n this._setClasses(element);\n this._emitOrigin(elementInfo, null);\n }\n _emitOrigin(info, origin) {\n if (info.subject.observers.length) {\n this._ngZone.run(() => info.subject.next(origin));\n }\n }\n _registerGlobalListeners(elementInfo) {\n if (!this._platform.isBrowser) {\n return;\n }\n const rootNode = elementInfo.rootNode;\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0;\n if (!rootNodeFocusListeners) {\n this._ngZone.runOutsideAngular(() => {\n rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n });\n }\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1);\n // Register global listeners when first element is monitored.\n if (++this._monitoredElementCount === 1) {\n // Note: we listen to events in the capture phase so we\n // can detect them even if the user stops propagation.\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n window.addEventListener('focus', this._windowFocusListener);\n });\n // The InputModalityDetector is also just a collection of global listeners.\n this._inputModalityDetector.modalityDetected\n .pipe(takeUntil(this._stopInputModalityDetector))\n .subscribe(modality => {\n this._setOrigin(modality, true /* isFromInteraction */);\n });\n }\n }\n _removeGlobalListeners(elementInfo) {\n const rootNode = elementInfo.rootNode;\n if (this._rootNodeFocusListenerCount.has(rootNode)) {\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode);\n if (rootNodeFocusListeners > 1) {\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1);\n }\n else {\n rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n this._rootNodeFocusListenerCount.delete(rootNode);\n }\n }\n // Unregister global listeners when last element is unmonitored.\n if (!--this._monitoredElementCount) {\n const window = this._getWindow();\n window.removeEventListener('focus', this._windowFocusListener);\n // Equivalently, stop our InputModalityDetector subscription.\n this._stopInputModalityDetector.next();\n // Clear timeouts for all potentially pending timeouts to prevent the leaks.\n clearTimeout(this._windowFocusTimeoutId);\n clearTimeout(this._originTimeoutId);\n }\n }\n /** Updates all the state on an element once its focus origin has changed. */\n _originChanged(element, origin, elementInfo) {\n this._setClasses(element, origin);\n this._emitOrigin(elementInfo, origin);\n this._lastFocusOrigin = origin;\n }\n /**\n * Collects the `MonitoredElementInfo` of a particular element and\n * all of its ancestors that have enabled `checkChildren`.\n * @param element Element from which to start the search.\n */\n _getClosestElementsInfo(element) {\n const results = [];\n this._elementInfo.forEach((info, currentElement) => {\n if (currentElement === element || (info.checkChildren && currentElement.contains(element))) {\n results.push([currentElement, info]);\n }\n });\n return results;\n }\n /**\n * Returns whether an interaction is likely to have come from the user clicking the `label` of\n * an `input` or `textarea` in order to focus it.\n * @param focusEventTarget Target currently receiving focus.\n */\n _isLastInteractionFromInputLabel(focusEventTarget) {\n const { _mostRecentTarget: mostRecentTarget, mostRecentModality } = this._inputModalityDetector;\n // If the last interaction used the mouse on an element contained by one of the labels\n // of an `input`/`textarea` that is currently focused, it is very likely that the\n // user redirected focus using the label.\n if (mostRecentModality !== 'mouse' ||\n !mostRecentTarget ||\n mostRecentTarget === focusEventTarget ||\n (focusEventTarget.nodeName !== 'INPUT' && focusEventTarget.nodeName !== 'TEXTAREA') ||\n focusEventTarget.disabled) {\n return false;\n }\n const labels = focusEventTarget.labels;\n if (labels) {\n for (let i = 0; i < labels.length; i++) {\n if (labels[i].contains(mostRecentTarget)) {\n return true;\n }\n }\n }\n return false;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusMonitor, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: InputModalityDetector }, { token: DOCUMENT, optional: true }, { token: FOCUS_MONITOR_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusMonitor, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FocusMonitor, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i0.NgZone }, { type: i1.Platform }, { type: InputModalityDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_MONITOR_DEFAULT_OPTIONS]\n }] }] });\n/**\n * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or\n * programmatically) and adds corresponding classes to the element.\n *\n * There are two variants of this directive:\n * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is\n * focused.\n * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused.\n */\nclass CdkMonitorFocus {\n constructor(_elementRef, _focusMonitor) {\n this._elementRef = _elementRef;\n this._focusMonitor = _focusMonitor;\n this._focusOrigin = null;\n this.cdkFocusChange = new EventEmitter();\n }\n get focusOrigin() {\n return this._focusOrigin;\n }\n ngAfterViewInit() {\n const element = this._elementRef.nativeElement;\n this._monitorSubscription = this._focusMonitor\n .monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus'))\n .subscribe(origin => {\n this._focusOrigin = origin;\n this.cdkFocusChange.emit(origin);\n });\n }\n ngOnDestroy() {\n this._focusMonitor.stopMonitoring(this._elementRef);\n if (this._monitorSubscription) {\n this._monitorSubscription.unsubscribe();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkMonitorFocus, deps: [{ token: i0.ElementRef }, { token: FocusMonitor }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkMonitorFocus, isStandalone: true, selector: \"[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]\", outputs: { cdkFocusChange: \"cdkFocusChange\" }, exportAs: [\"cdkMonitorFocus\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkMonitorFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]',\n exportAs: 'cdkMonitorFocus',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: FocusMonitor }], propDecorators: { cdkFocusChange: [{\n type: Output\n }] } });\n\n/** Set of possible high-contrast mode backgrounds. */\nvar HighContrastMode;\n(function (HighContrastMode) {\n HighContrastMode[HighContrastMode[\"NONE\"] = 0] = \"NONE\";\n HighContrastMode[HighContrastMode[\"BLACK_ON_WHITE\"] = 1] = \"BLACK_ON_WHITE\";\n HighContrastMode[HighContrastMode[\"WHITE_ON_BLACK\"] = 2] = \"WHITE_ON_BLACK\";\n})(HighContrastMode || (HighContrastMode = {}));\n/** CSS class applied to the document body when in black-on-white high-contrast mode. */\nconst BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white';\n/** CSS class applied to the document body when in white-on-black high-contrast mode. */\nconst WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black';\n/** CSS class applied to the document body when in high-contrast mode. */\nconst HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active';\n/**\n * Service to determine whether the browser is currently in a high-contrast-mode environment.\n *\n * Microsoft Windows supports an accessibility feature called \"High Contrast Mode\". This mode\n * changes the appearance of all applications, including web applications, to dramatically increase\n * contrast.\n *\n * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast\n * Mode. This service does not detect high-contrast mode as added by the Chrome \"High Contrast\"\n * browser extension.\n */\nclass HighContrastModeDetector {\n constructor(_platform, document) {\n this._platform = _platform;\n this._document = document;\n this._breakpointSubscription = inject(BreakpointObserver)\n .observe('(forced-colors: active)')\n .subscribe(() => {\n if (this._hasCheckedHighContrastMode) {\n this._hasCheckedHighContrastMode = false;\n this._applyBodyHighContrastModeCssClasses();\n }\n });\n }\n /** Gets the current high-contrast-mode for the page. */\n getHighContrastMode() {\n if (!this._platform.isBrowser) {\n return HighContrastMode.NONE;\n }\n // Create a test element with an arbitrary background-color that is neither black nor\n // white; high-contrast mode will coerce the color to either black or white. Also ensure that\n // appending the test element to the DOM does not affect layout by absolutely positioning it\n const testElement = this._document.createElement('div');\n testElement.style.backgroundColor = 'rgb(1,2,3)';\n testElement.style.position = 'absolute';\n this._document.body.appendChild(testElement);\n // Get the computed style for the background color, collapsing spaces to normalize between\n // browsers. Once we get this color, we no longer need the test element. Access the `window`\n // via the document so we can fake it in tests. Note that we have extra null checks, because\n // this logic will likely run during app bootstrap and throwing can break the entire app.\n const documentWindow = this._document.defaultView || window;\n const computedStyle = documentWindow && documentWindow.getComputedStyle\n ? documentWindow.getComputedStyle(testElement)\n : null;\n const computedColor = ((computedStyle && computedStyle.backgroundColor) || '').replace(/ /g, '');\n testElement.remove();\n switch (computedColor) {\n // Pre Windows 11 dark theme.\n case 'rgb(0,0,0)':\n // Windows 11 dark themes.\n case 'rgb(45,50,54)':\n case 'rgb(32,32,32)':\n return HighContrastMode.WHITE_ON_BLACK;\n // Pre Windows 11 light theme.\n case 'rgb(255,255,255)':\n // Windows 11 light theme.\n case 'rgb(255,250,239)':\n return HighContrastMode.BLACK_ON_WHITE;\n }\n return HighContrastMode.NONE;\n }\n ngOnDestroy() {\n this._breakpointSubscription.unsubscribe();\n }\n /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */\n _applyBodyHighContrastModeCssClasses() {\n if (!this._hasCheckedHighContrastMode && this._platform.isBrowser && this._document.body) {\n const bodyClasses = this._document.body.classList;\n bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, BLACK_ON_WHITE_CSS_CLASS, WHITE_ON_BLACK_CSS_CLASS);\n this._hasCheckedHighContrastMode = true;\n const mode = this.getHighContrastMode();\n if (mode === HighContrastMode.BLACK_ON_WHITE) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, BLACK_ON_WHITE_CSS_CLASS);\n }\n else if (mode === HighContrastMode.WHITE_ON_BLACK) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, WHITE_ON_BLACK_CSS_CLASS);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: HighContrastModeDetector, deps: [{ token: i1.Platform }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: HighContrastModeDetector, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: HighContrastModeDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n\nclass A11yModule {\n constructor(highContrastModeDetector) {\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: A11yModule, deps: [{ token: HighContrastModeDetector }], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: A11yModule, imports: [ObserversModule, CdkAriaLive, CdkTrapFocus, CdkMonitorFocus], exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: A11yModule, imports: [ObserversModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: A11yModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [ObserversModule, CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n }]\n }], ctorParameters: () => [{ type: HighContrastModeDetector }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusMonitorDetectionMode, FocusTrap, FocusTrapFactory, HighContrastMode, HighContrastModeDetector, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS, INPUT_MODALITY_DETECTOR_OPTIONS, InputModalityDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, NOOP_TREE_KEY_MANAGER_FACTORY, NOOP_TREE_KEY_MANAGER_FACTORY_PROVIDER, NoopTreeKeyManager, TREE_KEY_MANAGER, TREE_KEY_MANAGER_FACTORY, TREE_KEY_MANAGER_FACTORY_PROVIDER, TreeKeyManager, addAriaReferencedId, getAriaReferenceIds, isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader, removeAriaReferencedId };\n","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-browser because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/** Regex that matches locales with an RTL script. Taken from `goog.i18n.bidi.isRtlLanguage`. */\nconst RTL_LOCALE_PATTERN = /^(ar|ckb|dv|he|iw|fa|nqo|ps|sd|ug|ur|yi|.*[-_](Adlm|Arab|Hebr|Nkoo|Rohg|Thaa))(?!.*[-_](Latn|Cyrl)($|-|_))($|-|_)/i;\n/** Resolves a string value to a specific direction. */\nfunction _resolveDirectionality(rawValue) {\n const value = rawValue?.toLowerCase() || '';\n if (value === 'auto' && typeof navigator !== 'undefined' && navigator?.language) {\n return RTL_LOCALE_PATTERN.test(navigator.language) ? 'rtl' : 'ltr';\n }\n return value === 'rtl' ? 'rtl' : 'ltr';\n}\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n this.value = _resolveDirectionality(bodyDir || htmlDir || 'ltr');\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Directionality, deps: [{ token: DIR_DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Directionality, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Directionality, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }] });\n\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() {\n return this._dir;\n }\n set dir(value) {\n const previousValue = this._dir;\n // Note: `_resolveDirectionality` resolves the language based on the browser's language,\n // whereas the browser does it based on the content of the element. Since doing so based\n // on the content can be expensive, for now we're doing the simpler matching.\n this._dir = _resolveDirectionality(value);\n this._rawDir = value;\n if (previousValue !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() {\n return this.dir;\n }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Dir, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: Dir, isStandalone: true, selector: \"[dir]\", inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, host: { properties: { \"attr.dir\": \"_rawDir\" } }, providers: [{ provide: Directionality, useExisting: Dir }], exportAs: [\"dir\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Dir, decorators: [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir',\n standalone: true,\n }]\n }], propDecorators: { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] } });\n\nclass BidiModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BidiModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BidiModule, imports: [Dir], exports: [Dir] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BidiModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BidiModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [Dir],\n exports: [Dir],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality };\n","import { ElementRef } from '@angular/core';\n\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n if (_isNumberValue(value)) {\n return Number(value);\n }\n return arguments.length === 2 ? fallbackValue : 0;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n","import * as i1 from '@angular/cdk/a11y';\nimport { A11yModule } from '@angular/cdk/a11y';\nimport * as i1$1 from '@angular/cdk/overlay';\nimport { Overlay, OverlayConfig, OverlayRef, OverlayModule } from '@angular/cdk/overlay';\nimport { Platform, _getFocusedElementPierceShadowDom } from '@angular/cdk/platform';\nimport { BasePortalOutlet, CdkPortalOutlet, ComponentPortal, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { inject, ChangeDetectorRef, Injector, afterNextRender, Component, ViewEncapsulation, ChangeDetectionStrategy, Optional, Inject, ViewChild, InjectionToken, TemplateRef, Injectable, SkipSelf, NgModule } from '@angular/core';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\nimport { Subject, defer, of } from 'rxjs';\nimport { Directionality } from '@angular/cdk/bidi';\nimport { startWith } from 'rxjs/operators';\n\n/** Configuration for opening a modal dialog. */\nclass DialogConfig {\n constructor() {\n /** The ARIA role of the dialog element. */\n this.role = 'dialog';\n /** Optional CSS class or classes applied to the overlay panel. */\n this.panelClass = '';\n /** Whether the dialog has a backdrop. */\n this.hasBackdrop = true;\n /** Optional CSS class or classes applied to the overlay backdrop. */\n this.backdropClass = '';\n /** Whether the dialog closes with the escape key or pointer events outside the panel element. */\n this.disableClose = false;\n /** Width of the dialog. */\n this.width = '';\n /** Height of the dialog. */\n this.height = '';\n /** Data being injected into the child component. */\n this.data = null;\n /** ID of the element that describes the dialog. */\n this.ariaDescribedBy = null;\n /** ID of the element that labels the dialog. */\n this.ariaLabelledBy = null;\n /** Dialog label applied via `aria-label` */\n this.ariaLabel = null;\n /** Whether this is a modal dialog. Used to set the `aria-modal` attribute. */\n this.ariaModal = true;\n /**\n * Where the dialog should focus on open.\n * @breaking-change 14.0.0 Remove boolean option from autoFocus. Use string or\n * AutoFocusTarget instead.\n */\n this.autoFocus = 'first-tabbable';\n /**\n * Whether the dialog should restore focus to the previously-focused element upon closing.\n * Has the following behavior based on the type that is passed in:\n * - `boolean` - when true, will return focus to the element that was focused before the dialog\n * was opened, otherwise won't restore focus at all.\n * - `string` - focus will be restored to the first element that matches the CSS selector.\n * - `HTMLElement` - focus will be restored to the specific element.\n */\n this.restoreFocus = true;\n /**\n * Whether the dialog should close when the user navigates backwards or forwards through browser\n * history. This does not apply to navigation via anchor element unless using URL-hash based\n * routing (`HashLocationStrategy` in the Angular router).\n */\n this.closeOnNavigation = true;\n /**\n * Whether the dialog should close when the dialog service is destroyed. This is useful if\n * another service is wrapping the dialog and is managing the destruction instead.\n */\n this.closeOnDestroy = true;\n /**\n * Whether the dialog should close when the underlying overlay is detached. This is useful if\n * another service is wrapping the dialog and is managing the destruction instead. E.g. an\n * external detachment can happen as a result of a scroll strategy triggering it or when the\n * browser location changes.\n */\n this.closeOnOverlayDetachments = true;\n }\n}\n\nfunction throwDialogContentAlreadyAttachedError() {\n throw Error('Attempting to attach dialog content after content is already attached');\n}\n/**\n * Internal component that wraps user-provided dialog content.\n * @docs-private\n */\nclass CdkDialogContainer extends BasePortalOutlet {\n constructor(_elementRef, _focusTrapFactory, _document, _config, _interactivityChecker, _ngZone, _overlayRef, _focusMonitor) {\n super();\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n this._config = _config;\n this._interactivityChecker = _interactivityChecker;\n this._ngZone = _ngZone;\n this._overlayRef = _overlayRef;\n this._focusMonitor = _focusMonitor;\n this._platform = inject(Platform);\n /** The class that traps and manages focus within the dialog. */\n this._focusTrap = null;\n /** Element that was focused before the dialog was opened. Save this to restore upon close. */\n this._elementFocusedBeforeDialogWasOpened = null;\n /**\n * Type of interaction that led to the dialog being closed. This is used to determine\n * whether the focus style will be applied when returning focus to its original location\n * after the dialog is closed.\n */\n this._closeInteractionType = null;\n /**\n * Queue of the IDs of the dialog's label element, based on their definition order. The first\n * ID will be used as the `aria-labelledby` value. We use a queue here to handle the case\n * where there are two or more titles in the DOM at a time and the first one is destroyed while\n * the rest are present.\n */\n this._ariaLabelledByQueue = [];\n this._changeDetectorRef = inject(ChangeDetectorRef);\n this._injector = inject(Injector);\n this._isDestroyed = false;\n /**\n * Attaches a DOM portal to the dialog container.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n if (this._portalOutlet.hasAttached() && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throwDialogContentAlreadyAttachedError();\n }\n const result = this._portalOutlet.attachDomPortal(portal);\n this._contentAttached();\n return result;\n };\n this._document = _document;\n if (this._config.ariaLabelledBy) {\n this._ariaLabelledByQueue.push(this._config.ariaLabelledBy);\n }\n }\n _addAriaLabelledBy(id) {\n this._ariaLabelledByQueue.push(id);\n this._changeDetectorRef.markForCheck();\n }\n _removeAriaLabelledBy(id) {\n const index = this._ariaLabelledByQueue.indexOf(id);\n if (index > -1) {\n this._ariaLabelledByQueue.splice(index, 1);\n this._changeDetectorRef.markForCheck();\n }\n }\n _contentAttached() {\n this._initializeFocusTrap();\n this._handleBackdropClicks();\n this._captureInitialFocus();\n }\n /**\n * Can be used by child classes to customize the initial focus\n * capturing behavior (e.g. if it's tied to an animation).\n */\n _captureInitialFocus() {\n this._trapFocus();\n }\n ngOnDestroy() {\n this._isDestroyed = true;\n this._restoreFocus();\n }\n /**\n * Attach a ComponentPortal as content to this dialog container.\n * @param portal Portal to be attached as the dialog content.\n */\n attachComponentPortal(portal) {\n if (this._portalOutlet.hasAttached() && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throwDialogContentAlreadyAttachedError();\n }\n const result = this._portalOutlet.attachComponentPortal(portal);\n this._contentAttached();\n return result;\n }\n /**\n * Attach a TemplatePortal as content to this dialog container.\n * @param portal Portal to be attached as the dialog content.\n */\n attachTemplatePortal(portal) {\n if (this._portalOutlet.hasAttached() && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throwDialogContentAlreadyAttachedError();\n }\n const result = this._portalOutlet.attachTemplatePortal(portal);\n this._contentAttached();\n return result;\n }\n // TODO(crisbeto): this shouldn't be exposed, but there are internal references to it.\n /** Captures focus if it isn't already inside the dialog. */\n _recaptureFocus() {\n if (!this._containsFocus()) {\n this._trapFocus();\n }\n }\n /**\n * Focuses the provided element. If the element is not focusable, it will add a tabIndex\n * attribute to forcefully focus it. The attribute is removed after focus is moved.\n * @param element The element to focus.\n */\n _forceFocus(element, options) {\n if (!this._interactivityChecker.isFocusable(element)) {\n element.tabIndex = -1;\n // The tabindex attribute should be removed to avoid navigating to that element again\n this._ngZone.runOutsideAngular(() => {\n const callback = () => {\n element.removeEventListener('blur', callback);\n element.removeEventListener('mousedown', callback);\n element.removeAttribute('tabindex');\n };\n element.addEventListener('blur', callback);\n element.addEventListener('mousedown', callback);\n });\n }\n element.focus(options);\n }\n /**\n * Focuses the first element that matches the given selector within the focus trap.\n * @param selector The CSS selector for the element to set focus to.\n */\n _focusByCssSelector(selector, options) {\n let elementToFocus = this._elementRef.nativeElement.querySelector(selector);\n if (elementToFocus) {\n this._forceFocus(elementToFocus, options);\n }\n }\n /**\n * Moves the focus inside the focus trap. When autoFocus is not set to 'dialog', if focus\n * cannot be moved then focus will go to the dialog container.\n */\n _trapFocus() {\n if (this._isDestroyed) {\n return;\n }\n // If were to attempt to focus immediately, then the content of the dialog would not yet be\n // ready in instances where change detection has to run first. To deal with this, we simply\n // wait until after the next render.\n afterNextRender(() => {\n const element = this._elementRef.nativeElement;\n switch (this._config.autoFocus) {\n case false:\n case 'dialog':\n // Ensure that focus is on the dialog container. It's possible that a different\n // component tried to move focus while the open animation was running. See:\n // https://github.com/angular/components/issues/16215. Note that we only want to do this\n // if the focus isn't inside the dialog already, because it's possible that the consumer\n // turned off `autoFocus` in order to move focus themselves.\n if (!this._containsFocus()) {\n element.focus();\n }\n break;\n case true:\n case 'first-tabbable':\n const focusedSuccessfully = this._focusTrap?.focusInitialElement();\n // If we weren't able to find a focusable element in the dialog, then focus the dialog\n // container instead.\n if (!focusedSuccessfully) {\n this._focusDialogContainer();\n }\n break;\n case 'first-heading':\n this._focusByCssSelector('h1, h2, h3, h4, h5, h6, [role=\"heading\"]');\n break;\n default:\n this._focusByCssSelector(this._config.autoFocus);\n break;\n }\n }, { injector: this._injector });\n }\n /** Restores focus to the element that was focused before the dialog opened. */\n _restoreFocus() {\n const focusConfig = this._config.restoreFocus;\n let focusTargetElement = null;\n if (typeof focusConfig === 'string') {\n focusTargetElement = this._document.querySelector(focusConfig);\n }\n else if (typeof focusConfig === 'boolean') {\n focusTargetElement = focusConfig ? this._elementFocusedBeforeDialogWasOpened : null;\n }\n else if (focusConfig) {\n focusTargetElement = focusConfig;\n }\n // We need the extra check, because IE can set the `activeElement` to null in some cases.\n if (this._config.restoreFocus &&\n focusTargetElement &&\n typeof focusTargetElement.focus === 'function') {\n const activeElement = _getFocusedElementPierceShadowDom();\n const element = this._elementRef.nativeElement;\n // Make sure that focus is still inside the dialog or is on the body (usually because a\n // non-focusable element like the backdrop was clicked) before moving it. It's possible that\n // the consumer moved it themselves before the animation was done, in which case we shouldn't\n // do anything.\n if (!activeElement ||\n activeElement === this._document.body ||\n activeElement === element ||\n element.contains(activeElement)) {\n if (this._focusMonitor) {\n this._focusMonitor.focusVia(focusTargetElement, this._closeInteractionType);\n this._closeInteractionType = null;\n }\n else {\n focusTargetElement.focus();\n }\n }\n }\n if (this._focusTrap) {\n this._focusTrap.destroy();\n }\n }\n /** Focuses the dialog container. */\n _focusDialogContainer() {\n // Note that there is no focus method when rendering on the server.\n if (this._elementRef.nativeElement.focus) {\n this._elementRef.nativeElement.focus();\n }\n }\n /** Returns whether focus is inside the dialog. */\n _containsFocus() {\n const element = this._elementRef.nativeElement;\n const activeElement = _getFocusedElementPierceShadowDom();\n return element === activeElement || element.contains(activeElement);\n }\n /** Sets up the focus trap. */\n _initializeFocusTrap() {\n if (this._platform.isBrowser) {\n this._focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement);\n // Save the previously focused element. This element will be re-focused\n // when the dialog closes.\n if (this._document) {\n this._elementFocusedBeforeDialogWasOpened = _getFocusedElementPierceShadowDom();\n }\n }\n }\n /** Sets up the listener that handles clicks on the dialog backdrop. */\n _handleBackdropClicks() {\n // Clicking on the backdrop will move focus out of dialog.\n // Recapture it if closing via the backdrop is disabled.\n this._overlayRef.backdropClick().subscribe(() => {\n if (this._config.disableClose) {\n this._recaptureFocus();\n }\n });\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkDialogContainer, deps: [{ token: i0.ElementRef }, { token: i1.FocusTrapFactory }, { token: DOCUMENT, optional: true }, { token: DialogConfig }, { token: i1.InteractivityChecker }, { token: i0.NgZone }, { token: i1$1.OverlayRef }, { token: i1.FocusMonitor }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkDialogContainer, isStandalone: true, selector: \"cdk-dialog-container\", host: { attributes: { \"tabindex\": \"-1\" }, properties: { \"attr.id\": \"_config.id || null\", \"attr.role\": \"_config.role\", \"attr.aria-modal\": \"_config.ariaModal\", \"attr.aria-labelledby\": \"_config.ariaLabel ? null : _ariaLabelledByQueue[0]\", \"attr.aria-label\": \"_config.ariaLabel\", \"attr.aria-describedby\": \"_config.ariaDescribedBy || null\" }, classAttribute: \"cdk-dialog-container\" }, viewQueries: [{ propertyName: \"_portalOutlet\", first: true, predicate: CdkPortalOutlet, descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n\\n\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollViewport, decorators: [{\n type: Component,\n args: [{ selector: 'cdk-virtual-scroll-viewport', host: {\n 'class': 'cdk-virtual-scroll-viewport',\n '[class.cdk-virtual-scroll-orientation-horizontal]': 'orientation === \"horizontal\"',\n '[class.cdk-virtual-scroll-orientation-vertical]': 'orientation !== \"horizontal\"',\n }, encapsulation: ViewEncapsulation.None, changeDetection: ChangeDetectionStrategy.OnPush, standalone: true, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], template: \"\\n\\n
\\n\\n\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"] }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }, { type: CdkVirtualScrollable, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLLABLE]\n }] }], propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n if (this.viewChange.observers.length) {\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n }\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualForOf, isStandalone: true, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }], propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * Provides a virtual scrollable for the element it is attached to.\n */\nclass CdkVirtualScrollableElement extends CdkVirtualScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return (this.getElementRef().nativeElement.getBoundingClientRect()[from] -\n this.measureScrollOffset(from));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableElement, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollableElement, isStandalone: true, selector: \"[cdkVirtualScrollingElement]\", host: { classAttribute: \"cdk-virtual-scrollable\" }, providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableElement, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualScrollingElement]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }],\n standalone: true,\n host: {\n 'class': 'cdk-virtual-scrollable',\n },\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\n/**\n * Provides as virtual scrollable for the global / window scrollbar.\n */\nclass CdkVirtualScrollableWindow extends CdkVirtualScrollable {\n constructor(scrollDispatcher, ngZone, dir) {\n super(new ElementRef(document.documentElement), scrollDispatcher, ngZone, dir);\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(document, 'scroll').pipe(takeUntil(this._destroyed)).subscribe(observer)));\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableWindow, deps: [{ token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollableWindow, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[scrollWindow]\", providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableWindow, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[scrollWindow]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\nclass CdkScrollableModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, imports: [CdkScrollable], exports: [CdkScrollable] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n imports: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, imports: [BidiModule, CdkScrollableModule, CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, imports: [BidiModule,\n CdkScrollableModule, BidiModule, CdkScrollableModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, CdkVirtualScrollable, CdkVirtualScrollableElement, CdkVirtualScrollableWindow, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLLABLE, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i6 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, Optional, untracked, afterRender, afterNextRender, ElementRef, EnvironmentInjector, ApplicationRef, ANIMATION_MODULE_TYPE, InjectionToken, inject, Directive, NgZone, EventEmitter, booleanAttribute, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, _getEventTarget, _isTestEnvironment } from '@angular/cdk/platform';\nimport { filter, takeUntil, takeWhile } from 'rxjs/operators';\nimport * as i5 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0).pipe(filter(scrollable => {\n return (!scrollable ||\n !this._overlayRef.overlayElement.contains(scrollable.getElementRef().nativeElement));\n }));\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollStrategyOptions, deps: [{ token: i1.ScrollDispatcher }, { token: i1.ViewportRuler }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollStrategyOptions, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollStrategyOptions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.ScrollDispatcher }, { type: i1.ViewportRuler }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the possible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BaseOverlayDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BaseOverlayDispatcher, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BaseOverlayDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._ngZone = _ngZone;\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n const keydownEvents = overlays[i]._keydownEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => keydownEvents.next(event));\n }\n else {\n keydownEvents.next(event);\n }\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._document.body.addEventListener('keydown', this._keydownListener));\n }\n else {\n this._document.body.addEventListener('keydown', this._keydownListener);\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayKeyboardDispatcher, deps: [{ token: DOCUMENT }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayKeyboardDispatcher, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayKeyboardDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }] });\n\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._cursorStyleIsSet = false;\n /** Store pointerdown event target to track origin of click. */\n this._pointerDownListener = (event) => {\n this._pointerDownEventTarget = _getEventTarget(event);\n };\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n const target = _getEventTarget(event);\n // In case of a click event, we want to check the origin of the click\n // (e.g. in case where a user starts a click inside the overlay and\n // releases the click outside of it).\n // This is done by using the event target of the preceding pointerdown event.\n // Every click event caused by a pointer device has a preceding pointerdown\n // event, unless the click was programmatically triggered (e.g. in a unit test).\n const origin = event.type === 'click' && this._pointerDownEventTarget\n ? this._pointerDownEventTarget\n : target;\n // Reset the stored pointerdown event target, to avoid having it interfere\n // in subsequent events.\n this._pointerDownEventTarget = null;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click (both origin and target of the click) dispatch the mouse event,\n // and proceed with the next overlay\n if (containsPierceShadowDom(overlayRef.overlayElement, target) ||\n containsPierceShadowDom(overlayRef.overlayElement, origin)) {\n break;\n }\n const outsidePointerEvents = overlayRef._outsidePointerEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => outsidePointerEvents.next(event));\n }\n else {\n outsidePointerEvents.next(event);\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._addEventListeners(body));\n }\n else {\n this._addEventListeners(body);\n }\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('pointerdown', this._pointerDownListener, true);\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n _addEventListeners(body) {\n body.addEventListener('pointerdown', this._pointerDownListener, true);\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayOutsideClickDispatcher, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayOutsideClickDispatcher, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayOutsideClickDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }] });\n/** Version of `Element.contains` that transcends shadow DOM boundaries. */\nfunction containsPierceShadowDom(parent, child) {\n const supportsShadowRoot = typeof ShadowRoot !== 'undefined' && ShadowRoot;\n let current = child;\n while (current) {\n if (current === parent) {\n return true;\n }\n current =\n supportsShadowRoot && current instanceof ShadowRoot ? current.host : current.parentNode;\n }\n return false;\n}\n\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n this._containerElement?.remove();\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n // TODO(crisbeto): remove the testing check once we have an overlay testing\n // module or Angular starts tearing down the testing `NgModule`. See:\n // https://github.com/angular/angular/issues/18831\n if (this._platform.isBrowser || _isTestEnvironment()) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` + `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].remove();\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (_isTestEnvironment()) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayContainer, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }] });\n\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher, _animationsDisabled = false, _injector) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsDisabled = _animationsDisabled;\n this._injector = _injector;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n this._backdropTransitionendHandler = (event) => {\n this._disposeBackdrop(event.target);\n };\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n this._renders = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n // Users could open the overlay from an `effect`, in which case we need to\n // run the `afterRender` as `untracked`. We don't recommend that users do\n // this, but we also don't want to break users who are doing it.\n this._afterRenderRef = untracked(() => afterRender(() => {\n this._renders.next();\n }, { injector: this._injector }));\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n // Insert the host into the DOM before attaching the portal, otherwise\n // the animations module will skip animations on repeat attachments.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n const attachResult = this._portalOutlet.attach(portal);\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // We need to clean this up ourselves, because we're passing in an\n // `EnvironmentInjector` below which won't ever be destroyed.\n // Otherwise it causes some callbacks to be retained (see #29696).\n this._afterNextRenderRef?.destroy();\n // Update the position once the overlay is fully rendered before attempting to position it,\n // as the position may depend on the size of the rendered content.\n this._afterNextRenderRef = afterNextRender(() => {\n // The overlay could've been detached before the callback executed.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n }, { injector: this._injector });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n // TODO(crisbeto): the null check is here, because the portal outlet returns `any`.\n // We should be guaranteed for the result to be `ComponentRef | EmbeddedViewRef`, but\n // `instanceof EmbeddedViewRef` doesn't appear to work at the moment.\n if (typeof attachResult?.onDestroy === 'function') {\n // In most cases we control the portal and we know when it is being detached so that\n // we can finish the disposal process. The exception is if the user passes in a custom\n // `ViewContainerRef` that isn't destroyed through the overlay API. Note that we use\n // `detach` here instead of `dispose`, because we don't know if the user intends to\n // reattach the overlay at a later point. It also has the advantage of waiting for animations.\n attachResult.onDestroy(() => {\n if (this.hasAttached()) {\n // We have to delay the `detach` call, because detaching immediately prevents\n // other destroy hooks from running. This is likely a framework bug similar to\n // https://github.com/angular/angular/issues/46119\n this._ngZone.runOutsideAngular(() => Promise.resolve().then(() => this.detach()));\n }\n });\n }\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenEmpty();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this._disposeBackdrop(this._backdropElement);\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n this._host?.remove();\n this._afterNextRenderRef?.destroy();\n this._previousHostParent = this._pane = this._host = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n this._afterRenderRef.destroy();\n this._renders.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = { ...this._config, ...sizeConfig };\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = { ...this._config, direction: dir };\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._animationsDisabled) {\n this._backdropElement.classList.add('cdk-overlay-backdrop-noop-animation');\n }\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (!this._animationsDisabled && typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n const backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n if (this._animationsDisabled) {\n this._disposeBackdrop(backdropToDetach);\n return;\n }\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', this._backdropTransitionendHandler);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n this._backdropTimeout = this._ngZone.runOutsideAngular(() => setTimeout(() => {\n this._disposeBackdrop(backdropToDetach);\n }, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classes = coerceArray(cssClasses || []).filter(c => !!c);\n if (classes.length) {\n isAdd ? element.classList.add(...classes) : element.classList.remove(...classes);\n }\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenEmpty() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._renders\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._host.remove();\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n /** Removes a backdrop element from the DOM. */\n _disposeBackdrop(backdrop) {\n if (backdrop) {\n backdrop.removeEventListener('click', this._backdropClickHandler);\n backdrop.removeEventListener('transitionend', this._backdropTransitionendHandler);\n backdrop.remove();\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement === backdrop) {\n this._backdropElement = null;\n }\n }\n if (this._backdropTimeout) {\n clearTimeout(this._backdropTimeout);\n this._backdropTimeout = undefined;\n }\n }\n}\n\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef &&\n overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satisfies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin, the overlay and the container to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n const containerRect = this._containerRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, containerRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos),\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n const lastPosition = this._lastPosition;\n if (lastPosition) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originPoint = this._getOriginPoint(this._originRect, this._containerRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n else {\n this.apply();\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, containerRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + originRect.width / 2;\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n // When zooming in Safari the container rectangle contains negative values for the position\n // and we need to re-add them to the calculated coordinates.\n if (containerRect.left < 0) {\n x -= containerRect.left;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + originRect.height / 2;\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n // Normally the containerRect's top value would be zero, however when the overlay is attached to an input\n // (e.g. in an autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n // Additionally, when zooming in Safari this fixes the vertical position.\n if (containerRect.top < 0) {\n y -= containerRect.top;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = x + overlay.width - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = y + overlay.height - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: overlay.width * overlay.height === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlay at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occurring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param rawOverlayRect Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y,\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? viewport.left - scrollPosition.left - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? viewport.top - scrollPosition.top - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollVisibility = this._getScrollVisibility();\n // We're recalculating on scroll, but we only want to emit if anything\n // changed since downstream code might be hitting the `NgZone`.\n if (position !== this._lastPosition ||\n !this._lastScrollVisibility ||\n !compareScrollVisibility(this._lastScrollVisibility, scrollVisibility)) {\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollVisibility);\n this._positionChanges.next(changeEvent);\n }\n this._lastScrollVisibility = scrollVisibility;\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `DOMRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - previousHeight / 2;\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin * 2;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - previousWidth / 2;\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stretches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - 2 * this._viewportMargin,\n height: height - 2 * this._viewportMargin,\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breaking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the DOMRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width,\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return !units || units === 'px' ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `DOMRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `DOMRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height),\n };\n}\n/** Returns whether two `ScrollingVisibility` objects are identical. */\nfunction compareScrollVisibility(a, b) {\n if (a === b) {\n return true;\n }\n return (a.isOriginClipped === b.isOriginClipped &&\n a.isOriginOutsideView === b.isOriginOutsideView &&\n a.isOverlayClipped === b.isOverlayClipped &&\n a.isOverlayOutsideView === b.isOverlayOutsideView);\n}\nconst STANDARD_DROPDOWN_BELOW_POSITIONS = [\n { originX: 'start', originY: 'bottom', overlayX: 'start', overlayY: 'top' },\n { originX: 'start', originY: 'top', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'end', originY: 'bottom', overlayX: 'end', overlayY: 'top' },\n { originX: 'end', originY: 'top', overlayX: 'end', overlayY: 'bottom' },\n];\nconst STANDARD_DROPDOWN_ADJACENT_POSITIONS = [\n { originX: 'end', originY: 'top', overlayX: 'start', overlayY: 'top' },\n { originX: 'end', originY: 'bottom', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'start', originY: 'top', overlayX: 'end', overlayY: 'top' },\n { originX: 'start', originY: 'bottom', overlayX: 'end', overlayY: 'bottom' },\n];\n\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._alignItems = '';\n this._xPosition = '';\n this._xOffset = '';\n this._width = '';\n this._height = '';\n this._isDisposed = false;\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._xOffset = value;\n this._xPosition = 'left';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._xOffset = value;\n this._xPosition = 'right';\n return this;\n }\n /**\n * Sets the overlay to the start of the viewport, depending on the overlay direction.\n * This will be to the left in LTR layouts and to the right in RTL.\n * @param offset Offset from the edge of the screen.\n */\n start(value = '') {\n this._xOffset = value;\n this._xPosition = 'start';\n return this;\n }\n /**\n * Sets the overlay to the end of the viewport, depending on the overlay direction.\n * This will be to the right in LTR layouts and to the left in RTL.\n * @param offset Offset from the edge of the screen.\n */\n end(value = '') {\n this._xOffset = value;\n this._xPosition = 'end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._xPosition = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n const xPosition = this._xPosition;\n const xOffset = this._xOffset;\n const isRtl = this._overlayRef.getConfig().direction === 'rtl';\n let marginLeft = '';\n let marginRight = '';\n let justifyContent = '';\n if (shouldBeFlushHorizontally) {\n justifyContent = 'flex-start';\n }\n else if (xPosition === 'center') {\n justifyContent = 'center';\n if (isRtl) {\n marginRight = xOffset;\n }\n else {\n marginLeft = xOffset;\n }\n }\n else if (isRtl) {\n if (xPosition === 'left' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginRight = xOffset;\n }\n }\n else if (xPosition === 'left' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginRight = xOffset;\n }\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : marginLeft;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = shouldBeFlushHorizontally ? '0' : marginRight;\n parentStyles.justifyContent = justifyContent;\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent =\n parentStyles.alignItems =\n styles.marginTop =\n styles.marginBottom =\n styles.marginLeft =\n styles.marginRight =\n styles.position =\n '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayPositionBuilder, deps: [{ token: i1.ViewportRuler }, { token: DOCUMENT }, { token: i1$1.Platform }, { token: OverlayContainer }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayPositionBuilder, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayPositionBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: OverlayContainer }] });\n\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher, _animationsModuleType) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsModuleType = _animationsModuleType;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher, this._animationsModuleType === 'NoopAnimations', this._injector.get(EnvironmentInjector));\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Overlay, deps: [{ token: ScrollStrategyOptions }, { token: OverlayContainer }, { token: i0.ComponentFactoryResolver }, { token: OverlayPositionBuilder }, { token: OverlayKeyboardDispatcher }, { token: i0.Injector }, { token: i0.NgZone }, { token: DOCUMENT }, { token: i5.Directionality }, { token: i6.Location }, { token: OverlayOutsideClickDispatcher }, { token: ANIMATION_MODULE_TYPE, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Overlay, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Overlay, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: i0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: i0.Injector }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i5.Directionality }, { type: i6.Location }, { type: OverlayOutsideClickDispatcher }, { type: undefined, decorators: [{\n type: Inject,\n args: [ANIMATION_MODULE_TYPE]\n }, {\n type: Optional\n }] }] });\n\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top',\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top',\n },\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy', {\n providedIn: 'root',\n factory: () => {\n const overlay = inject(Overlay);\n return () => overlay.scrollStrategies.reposition();\n },\n});\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkOverlayOrigin, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkOverlayOrigin, isStandalone: true, selector: \"[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]\", exportAs: [\"cdkOverlayOrigin\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkOverlayOrigin, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }] });\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() {\n return this._offsetX;\n }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() {\n return this._offsetY;\n }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether the overlay should be disposed of when the user goes backwards/forwards in history. */\n get disposeOnNavigation() {\n return this._disposeOnNavigation;\n }\n set disposeOnNavigation(value) {\n this._disposeOnNavigation = value;\n }\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n this._disposeOnNavigation = false;\n this._ngZone = inject(NgZone);\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Whether or not the overlay should attach a backdrop. */\n this.hasBackdrop = false;\n /** Whether or not the overlay should be locked when scrolling. */\n this.lockPosition = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this.flexibleDimensions = false;\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n this.growAfterOpen = false;\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n this.push = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = (this._overlayRef = this._overlay.create(this._buildConfig()));\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n const origin = this._getOriginElement();\n const target = _getEventTarget(event);\n if (!origin || (origin !== target && !origin.contains(target))) {\n this.overlayOutsideClick.next(event);\n }\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = (this._position =\n this.positionStrategy || this._createPositionStrategy());\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop,\n disposeOnNavigation: this.disposeOnNavigation,\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this._getOrigin())\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay.position().flexibleConnectedTo(this._getOrigin());\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n _getOrigin() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef;\n }\n else {\n return this.origin;\n }\n }\n _getOriginElement() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef.nativeElement;\n }\n if (this.origin instanceof ElementRef) {\n return this.origin.nativeElement;\n }\n if (typeof Element !== 'undefined' && this.origin instanceof Element) {\n return this.origin;\n }\n return null;\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this._ngZone.run(() => this.positionChange.emit(position));\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkConnectedOverlay, deps: [{ token: Overlay }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY }, { token: i5.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkConnectedOverlay, isStandalone: true, selector: \"[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]\", inputs: { origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\", booleanAttribute], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\", booleanAttribute], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\", booleanAttribute], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\", booleanAttribute], push: [\"cdkConnectedOverlayPush\", \"push\", booleanAttribute], disposeOnNavigation: [\"cdkConnectedOverlayDisposeOnNavigation\", \"disposeOnNavigation\", booleanAttribute] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkConnectedOverlay, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: Overlay }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: i5.Directionality, decorators: [{\n type: Optional\n }] }], propDecorators: { origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }], hasBackdrop: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayHasBackdrop', transform: booleanAttribute }]\n }], lockPosition: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayLockPosition', transform: booleanAttribute }]\n }], flexibleDimensions: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayFlexibleDimensions', transform: booleanAttribute }]\n }], growAfterOpen: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayGrowAfterOpen', transform: booleanAttribute }]\n }], push: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayPush', transform: booleanAttribute }]\n }], disposeOnNavigation: [{\n type: Input,\n args: [{ alias: 'cdkConnectedOverlayDisposeOnNavigation', transform: booleanAttribute }]\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }] } });\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\nclass OverlayModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayModule, imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin], exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayModule, providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER], imports: [BidiModule, PortalModule, ScrollingModule, ScrollingModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: OverlayModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER],\n }]\n }] });\n\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return (_document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FullscreenOverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FullscreenOverlayContainer, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FullscreenOverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, STANDARD_DROPDOWN_ADJACENT_POSITIONS, STANDARD_DROPDOWN_BELOW_POSITIONS, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition };\n","import * as i0 from '@angular/core';\nimport { PLATFORM_ID, Injectable, Inject, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = typeof Intl !== 'undefined' && Intl.v8BreakIterator;\n}\ncatch {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId\n ? isPlatformBrowser(this._platformId)\n : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser &&\n !!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' &&\n !this.EDGE &&\n !this.TRIDENT;\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) &&\n !this.BLINK &&\n !this.EDGE &&\n !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Platform, deps: [{ token: PLATFORM_ID }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Platform, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: Platform, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }] });\n\nclass PlatformModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PlatformModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PlatformModule }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PlatformModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PlatformModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => (supportsPassiveEvents = true),\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/** The possible ways the browser may handle the horizontal scroll axis in RTL languages. */\nvar RtlScrollAxisType;\n(function (RtlScrollAxisType) {\n /**\n * scrollLeft is 0 when scrolled all the way left and (scrollWidth - clientWidth) when scrolled\n * all the way right.\n */\n RtlScrollAxisType[RtlScrollAxisType[\"NORMAL\"] = 0] = \"NORMAL\";\n /**\n * scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and 0 when scrolled\n * all the way right.\n */\n RtlScrollAxisType[RtlScrollAxisType[\"NEGATED\"] = 1] = \"NEGATED\";\n /**\n * scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and 0 when scrolled\n * all the way right.\n */\n RtlScrollAxisType[RtlScrollAxisType[\"INVERTED\"] = 2] = \"INVERTED\";\n})(RtlScrollAxisType || (RtlScrollAxisType = {}));\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return RtlScrollAxisType.NORMAL;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = RtlScrollAxisType.NORMAL;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? RtlScrollAxisType.NEGATED : RtlScrollAxisType.INVERTED;\n }\n scrollContainer.remove();\n }\n return rtlScrollAxisType;\n}\n\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document\n ? document.activeElement\n : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n/** Gets the target of an event while accounting for Shadow DOM. */\nfunction _getEventTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/** Gets whether the code is currently running in a test environment. */\nfunction _isTestEnvironment() {\n // We can't use `declare const` because it causes conflicts inside Google with the real typings\n // for these symbols and we can't read them off the global object, because they don't appear to\n // be attached there for some runners like Jest.\n // (see: https://github.com/angular/components/issues/23365#issuecomment-938146643)\n return (\n // @ts-ignore\n (typeof __karma__ !== 'undefined' && !!__karma__) ||\n // @ts-ignore\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n // @ts-ignore\n (typeof jest !== 'undefined' && !!jest) ||\n // @ts-ignore\n (typeof Mocha !== 'undefined' && !!Mocha));\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, RtlScrollAxisType, _getEventTarget, _getFocusedElementPierceShadowDom, _getShadowRoot, _isTestEnvironment, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n","import * as i0 from '@angular/core';\nimport { ElementRef, Injector, Directive, EventEmitter, Inject, Input, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver, projectableNodes) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n this.projectableNodes = projectableNodes;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(\n /** The embedded template that will be used to instantiate an embedded View in the host. */\n templateRef, \n /** Reference to the ViewContainer into which the template will be stamped out. */\n viewContainerRef, \n /** Contextual data to be passed in to the embedded view. */\n context, \n /** The injector to use for the embedded view. */\n injector) {\n super();\n this.templateRef = templateRef;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n this.injector = injector;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n /**\n * @param outletElement Element into which the content is projected.\n * @param _componentFactoryResolver Used to resolve the component factory.\n * Only required when attaching component portals.\n * @param _appRef Reference to the application. Only used in component portals when there\n * is no `ViewContainerRef` available.\n * @param _defaultInjector Injector to use as a fallback when the portal being attached doesn't\n * have one. Only used for component portals.\n * @param _document Reference to the document. Used when attaching a DOM portal. Will eventually\n * become a required parameter.\n */\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = (portal.componentFactoryResolver || this._componentFactoryResolver);\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !resolver) {\n throw Error('Cannot attach component portal to outlet without a ComponentFactoryResolver.');\n }\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector, portal.projectableNodes || undefined);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !this._appRef) {\n throw Error('Cannot attach component portal to outlet without an ApplicationRef.');\n }\n componentRef = componentFactory.create(portal.injector || this._defaultInjector || Injector.NULL);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n // Verify that the ApplicationRef has registered views before trying to detach a host view.\n // This check also protects the `detachView` from being called on a destroyed ApplicationRef.\n if (this._appRef.viewCount > 0) {\n this._appRef.detachView(componentRef.hostView);\n }\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn(() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n });\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n this.outletElement.remove();\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortal, deps: [{ token: i0.TemplateRef }, { token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkPortal, isStandalone: true, selector: \"[cdkPortal]\", exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortal, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }, { type: i0.ViewContainerRef }] });\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TemplatePortalDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: TemplatePortalDirective, isStandalone: true, selector: \"[cdk-portal], [portal]\", providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ], exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TemplatePortalDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ],\n standalone: true,\n }]\n }] });\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedRef = this._attachedPortal = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector, portal.projectableNodes || undefined);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkPortalOutlet, isStandalone: true, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }], propDecorators: { portal: [{\n type: Input,\n args: ['cdkPortalOutlet']\n }], attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: PortalHostDirective, isStandalone: true, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: [{ name: 'portal', alias: 'cdkPortalHost' }],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n standalone: true,\n }]\n }] });\nclass PortalModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, imports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","/**\n * @license Angular v18.2.8\n * (c) 2010-2024 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Optional, Inject, EventEmitter, ɵɵinject, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, untracked, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, PLATFORM_ID, ɵformatRuntimeError, ɵIMAGE_CONFIG, Renderer2, ElementRef, Injector, ɵperformanceMarkFeature, NgZone, ApplicationRef, ChangeDetectorRef, numberAttribute, booleanAttribute, ɵIMAGE_CONFIG_DEFAULTS, ɵwhenStable, ɵunwrapSafeValue } from '@angular/core';\nexport { ɵIMAGE_CONFIG as IMAGE_CONFIG } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n _DOM ??= adapter;\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * This class wraps the platform Navigation API which allows server-specific and test\n * implementations.\n */\nclass PlatformNavigation {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformNavigation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformNavigation, providedIn: 'platform', useFactory: () => window.navigation }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformNavigation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => window.navigation }]\n }] });\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken(ngDevMode ? 'DocumentToken' : '');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }]\n }] });\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? 'Location Initialized' : '');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor() {\n super();\n this._doc = inject(DOCUMENT);\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n this._history.pushState(state, title, url);\n }\n replaceState(state, title, url) {\n this._history.replaceState(state, title, url);\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserPlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: () => new BrowserPlatformLocation() }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n useFactory: () => new BrowserPlatformLocation(),\n }]\n }], ctorParameters: () => [] });\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = (match && match.index) || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_ngEl, _renderer) {\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach((klass) => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgClass, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.Renderer2 }], propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInputs`: Optional component inputs object, which will be bind to the\n * component.\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n /**\n * A helper data structure that allows us to track inputs that were part of the\n * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones\n * that are no longer referenced.\n */\n this._inputsUsed = new Map();\n }\n _needToReCreateNgModuleInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutletNgModule'] !== undefined ||\n changes['ngComponentOutletNgModuleFactory'] !== undefined);\n }\n _needToReCreateComponentInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutlet'] !== undefined ||\n changes['ngComponentOutletContent'] !== undefined ||\n changes['ngComponentOutletInjector'] !== undefined ||\n this._needToReCreateNgModuleInstance(changes));\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (this._needToReCreateComponentInstance(changes)) {\n this._viewContainerRef.clear();\n this._inputsUsed.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (this._needToReCreateNgModuleInstance(changes)) {\n this._moduleRef?.destroy();\n if (this.ngComponentOutletNgModule) {\n this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));\n }\n else if (this.ngComponentOutletNgModuleFactory) {\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n }\n /** @nodoc */\n ngDoCheck() {\n if (this._componentRef) {\n if (this.ngComponentOutletInputs) {\n for (const inputName of Object.keys(this.ngComponentOutletInputs)) {\n this._inputsUsed.set(inputName, true);\n }\n }\n this._applyInputStateDiff(this._componentRef);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n this._moduleRef?.destroy();\n }\n _applyInputStateDiff(componentRef) {\n for (const [inputName, touched] of this._inputsUsed) {\n if (!touched) {\n // The input that was previously active no longer exists and needs to be set to undefined.\n componentRef.setInput(inputName, undefined);\n this._inputsUsed.delete(inputName);\n }\n else {\n // Since touched is true, it can be asserted that the inputs object is not empty.\n componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);\n this._inputsUsed.set(inputName, false);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInputs: \"ngComponentOutletInputs\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }], propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInputs: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor(\n /** Reference to the current item from the collection. */\n $implicit, \n /**\n * The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe\n * (`userStreams | async`).\n */\n ngForOf, \n /** Returns an index of the current item in the collection. */\n index, \n /** Returns total amount of items in the collection. */\n count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n // Indicates whether this is the first item in the collection.\n get first() {\n return this.index === 0;\n }\n // Indicates whether this is the last item in the collection.\n get last() {\n return this.index === this.count - 1;\n }\n // Indicates whether an index of this item in the collection is even.\n get even() {\n return this.index % 2 === 0;\n }\n // Indicates whether an index of this item in the collection is odd.\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/directives/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/directives/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```\n * ... \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n * ... \n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/directives/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n * \n * {{i}}/{{users.length}}. {{user}} default\n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/animations/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/directives/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/directives/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see {@link TrackByFunction}\n */\n set ngForTrackBy(fn) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/templates/variables#template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }], propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/directives/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n * Content to render when condition is false. \n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n * \n * Content to render when condition is true. \n * Content to render when condition is false. \n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n * Content to render when value is null. \n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n * \n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n * \n *\n * \n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }], propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ... \n * ... \n * ... \n * \n * ... \n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ... \n * ... \n * ... \n * \n * \n * \n * ... \n * \n * ```\n *\n * @publicApi\n * @see {@link NgSwitchCase}\n * @see {@link NgSwitchDefault}\n * @see [Structural Directives](guide/directives/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value === this._ngSwitch;\n this._lastCasesMatched ||= matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * As of Angular v17 the NgSwitch directive uses strict equality comparison (`===`) instead of\n * loose equality (`==`) to match different cases.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchDefault}\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }], propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchCase}\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }] });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\nfunction stringifyValue(value) {\n return typeof value === 'string' ? `'${value}'` : String(value);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing \n * there is one \n * there are a few \n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: NgLocalization }], propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ... \n * ... \n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }] });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ... \n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.8\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }], propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n *
\n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n/locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n *
\n *
\n *b \n * c \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: CommonModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('18.2.8');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n // De-sugared tree-shakable injection\n // See #23917\n /** @nocollapse */\n static { this.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => isPlatformBrowser(inject(PLATFORM_ID))\n ? new BrowserViewportScroller(inject(DOCUMENT), window)\n : new NullViewportScroller(),\n }); }\n}\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n return [this.window.scrollX, this.window.scrollY];\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n this.window.scrollTo(position[0], position[1]);\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n this.window.history.scrollRestoration = scrollRestoration;\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' &&\n document.body &&\n typeof document.body.attachShadow === 'function') {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * Value (out of 100) of the requested quality for placeholder images.\n */\nconst PLACEHOLDER_QUALITY = '20';\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? new URL(url).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken(ngDevMode ? 'ImageLoader' : '', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`![]()
\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params += `,quality=${PLACEHOLDER_QUALITY}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl,\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode\n ? [\n 'https://res.cloudinary.com/mysite',\n 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com',\n ]\n : undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n // For a placeholder image, we use the lowest image setting available to reduce the load time\n // else we use the auto size\n const quality = config.isPlaceholder ? 'q_auto:low' : 'q_auto';\n let params = `f_auto,${quality}`;\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n const params = [];\n if (width) {\n params.push(`w-${width}`);\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params.push(`q-${PLACEHOLDER_QUALITY}`);\n }\n const urlSegments = params.length ? [path, `tr:${params.join(',')}`, src] : [path, src];\n const url = new URL(urlSegments.join('/'));\n return url.href;\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl,\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n return url.href;\n}\n\n/**\n * Name and URL tester for Netlify.\n */\nconst netlifyLoaderInfo = {\n name: 'Netlify',\n testUrl: isNetlifyUrl,\n};\nconst NETLIFY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.netlify\\.app\\/.+/;\n/**\n * Tests whether a URL is from a Netlify site. This won't catch sites with a custom domain,\n * but it's a good start for sites in development. This is only used to warn users who haven't\n * configured an image loader.\n */\nfunction isNetlifyUrl(url) {\n return NETLIFY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Netlify and turns it into an Angular provider.\n *\n * @param path optional URL of the desired Netlify site. Defaults to the current site.\n * @returns Set of providers to configure the Netlify loader.\n *\n * @publicApi\n */\nfunction provideNetlifyLoader(path) {\n if (path && !isValidPath(path)) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply either the full URL to the Netlify site, or leave it empty to use the current site.`);\n }\n if (path) {\n const url = new URL(path);\n path = url.origin;\n }\n const loaderFn = (config) => {\n return createNetlifyUrl(config, path);\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n}\nconst validParams = new Map([\n ['height', 'h'],\n ['fit', 'fit'],\n ['quality', 'q'],\n ['q', 'q'],\n ['position', 'position'],\n]);\nfunction createNetlifyUrl(config, path) {\n // Note: `path` can be undefined, in which case we use a fake one to construct a `URL` instance.\n const url = new URL(path ?? 'https://a/');\n url.pathname = '/.netlify/images';\n if (!isAbsoluteUrl(config.src) && !config.src.startsWith('/')) {\n config.src = '/' + config.src;\n }\n url.searchParams.set('url', config.src);\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n // If the quality is specified in the loader config - always use provided value.\n const configQuality = config.loaderParams?.['quality'] ?? config.loaderParams?.['q'];\n if (config.isPlaceholder && !configQuality) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n for (const [param, value] of Object.entries(config.loaderParams ?? {})) {\n if (validParams.has(param)) {\n url.searchParams.set(validParams.get(param), value.toString());\n }\n else {\n if (ngDevMode) {\n console.warn(ɵformatRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, `The Netlify image loader has detected an \\`![]()
\\` tag with the unsupported attribute \"\\`${param}\\`\".`));\n }\n }\n }\n // The \"a\" hostname is used for relative URLs, so we can remove it from the final URL.\n return url.hostname === 'a' ? url.href.replace(url.origin, '') : url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc\n ? `(activated on an ![]()
element with the \\`ngSrc=\"${ngSrc}\"\\`) `\n : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n this.window = null;\n this.observer = null;\n const isBrowser = isPlatformBrowser(inject(PLATFORM_ID));\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (isBrowser && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const img = this.images.get(imgSrc);\n if (!img)\n return;\n if (!img.priority && !img.alreadyWarnedPriority) {\n img.alreadyWarnedPriority = true;\n logMissingPriorityError(imgSrc);\n }\n if (img.modified && !img.alreadyWarnedModified) {\n img.alreadyWarnedModified = true;\n logModifiedWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc, isPriority) {\n if (!this.observer)\n return;\n const newObservedImageState = {\n priority: isPriority,\n modified: false,\n alreadyWarnedModified: false,\n alreadyWarnedPriority: false,\n };\n this.images.set(getUrl(rewrittenSrc, this.window).href, newObservedImageState);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n updateImage(originalSrc, newSrc) {\n if (!this.observer)\n return;\n const originalUrl = getUrl(originalSrc, this.window).href;\n const img = this.images.get(originalUrl);\n if (img) {\n img.modified = true;\n this.images.set(getUrl(newSrc, this.window).href, img);\n this.images.delete(originalUrl);\n }\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\nfunction logMissingPriorityError(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.error(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\nfunction logModifiedWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2964 /* RuntimeErrorCode.LCP_IMG_NGSRC_MODIFIED */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element and has had its \"ngSrc\" attribute modified. This can cause ` +\n `slower loading performance. It is recommended not to modify the \"ngSrc\" ` +\n `property on any image which could be the LCP element.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken(ngDevMode ? 'PRECONNECT_CHECK_BLOCKLIST' : '');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, (origin) => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (this.isServer)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks ??= this.queryPreconnectLinks();\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [] });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', {\n providedIn: 'root',\n factory: () => new Set(),\n});\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `![]()
` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = 0.1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/**\n * Default blur radius of the CSS filter used on placeholder images, in pixels\n */\nconst PLACEHOLDER_BLUR_AMOUNT = 15;\n/**\n * Placeholder dimension (height or width) limit in pixels. Angular produces a warning\n * when this limit is crossed.\n */\nconst PLACEHOLDER_DIMENSION_LIMIT = 1000;\n/**\n * Used to warn or error when the user provides an overly large dataURL for the placeholder\n * attribute.\n * Character count of Base64 images is 1 character per byte, and base64 encoding is approximately\n * 33% larger than base images, so 4000 characters is around 3KB on disk and 10000 characters is\n * around 7.7KB. Experimentally, 4000 characters is about 20x20px in PNG or medium-quality JPEG\n * format, and 10,000 is around 50x50px, but there's quite a bit of variation depending on how the\n * image is saved.\n */\nconst DATA_URL_WARN_LIMIT = 4000;\nconst DATA_URL_ERROR_LIMIT = 10000;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [\n imgixLoaderInfo,\n imageKitLoaderInfo,\n cloudinaryLoaderInfo,\n netlifyLoaderInfo,\n];\n/**\n * Threshold for the PRIORITY_TRUE_COUNT\n */\nconst PRIORITY_COUNT_THRESHOLD = 10;\n/**\n * This count is used to log a devMode warning\n * when the count of directive instances with priority=true\n * exceeds the threshold PRIORITY_COUNT_THRESHOLD\n */\nlet IMGS_WITH_PRIORITY_ATTR_COUNT = 0;\n/**\n * This function is for testing purpose.\n */\nfunction resetImagePriorityCount() {\n IMGS_WITH_PRIORITY_ATTR_COUNT = 0;\n}\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `![]()
` tag\n * - Lazy loading non-priority images by default\n * - Automatically generating a preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/components/importing) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `![]()
` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `![]()
` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * ![]()
\n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.config = processConfig(inject(ɵIMAGE_CONFIG));\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n this.preloadLinkCreator = inject(PreloadLinkCreator);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n /**\n * Indicates whether this image should have a high priority.\n */\n this.priority = false;\n /**\n * Disables automatic srcset generation for this image.\n */\n this.disableOptimizedSrcset = false;\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n */\n this.fill = false;\n }\n /** @nodoc */\n ngOnInit() {\n ɵperformanceMarkFeature('NgOptimizedImage');\n if (ngDevMode) {\n const ngZone = this.injector.get(NgZone);\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n // This leaves the Angular zone to avoid triggering unnecessary change detection cycles when\n // `load` tasks are invoked on images.\n ngZone.runOutsideAngular(() => assertNonZeroRenderedHeight(this, this.imgElement, this.renderer));\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n if (this.height !== undefined) {\n assertGreaterThanZero(this, this.height, 'height');\n }\n if (this.width !== undefined) {\n assertGreaterThanZero(this, this.width, 'width');\n }\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n ngZone.runOutsideAngular(() => assertNoImageDistortion(this, this.imgElement, this.renderer));\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertValidPlaceholder(this, this.imageLoader);\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc, this.priority);\n });\n }\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n if (!this.isServer) {\n const applicationRef = this.injector.get(ApplicationRef);\n assetPriorityCountBelowThreshold(applicationRef);\n }\n }\n }\n if (this.placeholder) {\n this.removePlaceholderOnLoad(this.imgElement);\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n this.sizes ||= '100vw';\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrcset = this.updateSrcAndSrcset();\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.isServer && this.priority) {\n this.preloadLinkCreator.createPreloadLinkTag(this.renderer, this.getRewrittenSrc(), rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n if (changes['ngSrc'] && !changes['ngSrc'].isFirstChange()) {\n const oldSrc = this._renderedSrc;\n this.updateSrcAndSrcset(true);\n const newSrc = this._renderedSrc;\n if (this.lcpObserver !== null && oldSrc && newSrc && oldSrc !== newSrc) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver?.updateImage(oldSrc, newSrc);\n });\n }\n }\n if (ngDevMode && changes['placeholder']?.currentValue && !this.isServer) {\n assertPlaceholderDimensions(this, this.imgElement);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset\n .split(',')\n .filter((src) => src !== '')\n .map((srcStr) => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter((bp) => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map((bp) => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n updateSrcAndSrcset(forceSrcRecalc = false) {\n if (forceSrcRecalc) {\n // Reset cached value, so that the followup `getRewrittenSrc()` call\n // will recalculate it and update the cache.\n this._renderedSrc = null;\n }\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n return rewrittenSrcset;\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map((multiplier) => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier,\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n let oversizedImage = false;\n if (!this.sizes) {\n oversizedImage =\n this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT;\n }\n return (!this.disableOptimizedSrcset &&\n !this.srcset &&\n this.imageLoader !== noopImageLoader &&\n !oversizedImage);\n }\n /**\n * Returns an image url formatted for use with the CSS background-image property. Expects one of:\n * * A base64 encoded image, which is wrapped and passed through.\n * * A boolean. If true, calls the image loader to generate a small placeholder url.\n */\n generatePlaceholder(placeholderInput) {\n const { placeholderResolution } = this.config;\n if (placeholderInput === true) {\n return `url(${this.callImageLoader({\n src: this.ngSrc,\n width: placeholderResolution,\n isPlaceholder: true,\n })})`;\n }\n else if (typeof placeholderInput === 'string') {\n return `url(${placeholderInput})`;\n }\n return null;\n }\n /**\n * Determines if blur should be applied, based on an optional boolean\n * property `blur` within the optional configuration object `placeholderConfig`.\n */\n shouldBlurPlaceholder(placeholderConfig) {\n if (!placeholderConfig || !placeholderConfig.hasOwnProperty('blur')) {\n return true;\n }\n return Boolean(placeholderConfig.blur);\n }\n removePlaceholderOnLoad(img) {\n const callback = () => {\n const changeDetectorRef = this.injector.get(ChangeDetectorRef);\n removeLoadListenerFn();\n removeErrorListenerFn();\n this.placeholder = false;\n changeDetectorRef.markForCheck();\n };\n const removeLoadListenerFn = this.renderer.listen(img, 'load', callback);\n const removeErrorListenerFn = this.renderer.listen(img, 'error', callback);\n callOnLoadIfImageIsLoaded(img, callback);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.8\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: [\"ngSrc\", \"ngSrc\", unwrapSafeUrl], ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: [\"width\", \"width\", numberAttribute], height: [\"height\", \"height\", numberAttribute], loading: \"loading\", priority: [\"priority\", \"priority\", booleanAttribute], loaderParams: \"loaderParams\", disableOptimizedSrcset: [\"disableOptimizedSrcset\", \"disableOptimizedSrcset\", booleanAttribute], fill: [\"fill\", \"fill\", booleanAttribute], placeholder: [\"placeholder\", \"placeholder\", booleanOrUrlAttribute], placeholderConfig: \"placeholderConfig\", src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0\\\" : null\", \"style.background-size\": \"placeholder ? \\\"cover\\\" : null\", \"style.background-position\": \"placeholder ? \\\"50% 50%\\\" : null\", \"style.background-repeat\": \"placeholder ? \\\"no-repeat\\\" : null\", \"style.background-image\": \"placeholder ? generatePlaceholder(placeholder) : null\", \"style.filter\": \"placeholder && shouldBlurPlaceholder(placeholderConfig) ? \\\"blur(15px)\\\" : null\" } }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0\" : null',\n '[style.background-size]': 'placeholder ? \"cover\" : null',\n '[style.background-position]': 'placeholder ? \"50% 50%\" : null',\n '[style.background-repeat]': 'placeholder ? \"no-repeat\" : null',\n '[style.background-image]': 'placeholder ? generatePlaceholder(placeholder) : null',\n '[style.filter]': `placeholder && shouldBlurPlaceholder(placeholderConfig) ? \"blur(${PLACEHOLDER_BLUR_AMOUNT}px)\" : null`,\n },\n }]\n }], propDecorators: { ngSrc: [{\n type: Input,\n args: [{ required: true, transform: unwrapSafeUrl }]\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], height: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], fill: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], placeholder: [{\n type: Input,\n args: [{ transform: booleanOrUrlAttribute }]\n }], placeholderConfig: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, ɵIMAGE_CONFIG_DEFAULTS, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\nfunction assertValidPlaceholder(dir, imageLoader) {\n assertNoPlaceholderConfigWithoutPlaceholder(dir);\n assertNoRelativePlaceholderWithoutLoader(dir, imageLoader);\n assertNoOversizedDataUrl(dir);\n}\n/**\n * Verifies that placeholderConfig isn't being used without placeholder\n */\nfunction assertNoPlaceholderConfigWithoutPlaceholder(dir) {\n if (dir.placeholderConfig && !dir.placeholder) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`placeholderConfig\\` options were provided for an ` +\n `image that does not use the \\`placeholder\\` attribute, and will have no effect.`);\n }\n}\n/**\n * Warns if a relative URL placeholder is specified, but no loader is present to provide the small\n * image.\n */\nfunction assertNoRelativePlaceholderWithoutLoader(dir, imageLoader) {\n if (dir.placeholder === true && imageLoader === noopImageLoader) {\n throw new ɵRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to true but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for the primary image and its placeholder. ` +\n `To fix this, provide a loader or remove the \\`placeholder\\` attribute from the image.`);\n }\n}\n/**\n * Warns or throws an error if an oversized dataURL placeholder is provided.\n */\nfunction assertNoOversizedDataUrl(dir) {\n if (dir.placeholder &&\n typeof dir.placeholder === 'string' &&\n dir.placeholder.startsWith('data:')) {\n if (dir.placeholder.length > DATA_URL_ERROR_LIMIT) {\n throw new ɵRuntimeError(2965 /* RuntimeErrorCode.OVERSIZED_PLACEHOLDER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to a data URL which is longer ` +\n `than ${DATA_URL_ERROR_LIMIT} characters. This is strongly discouraged, as large inline placeholders ` +\n `directly increase the bundle size of Angular and hurt page load performance. To fix this, generate ` +\n `a smaller data URL placeholder.`);\n }\n if (dir.placeholder.length > DATA_URL_WARN_LIMIT) {\n console.warn(ɵformatRuntimeError(2965 /* RuntimeErrorCode.OVERSIZED_PLACEHOLDER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`placeholder\\` attribute is set to a data URL which is longer ` +\n `than ${DATA_URL_WARN_LIMIT} characters. This is discouraged, as large inline placeholders ` +\n `directly increase the bundle size of Angular and hurt page load performance. For better loading performance, ` +\n `generate a smaller data URL placeholder.`));\n }\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value\n .split(',')\n .every((num) => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason =\n `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason =\n `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach((input) => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value. ` +\n `To fix this, provide \\`${inputName}\\` as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const callback = () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${round(suppliedAspectRatio)}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${round(intrinsicAspectRatio)}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${round(renderedAspectRatio)}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = intrinsicWidth - recommendedWidth >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = intrinsicHeight - recommendedHeight >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n };\n const removeLoadListenerFn = renderer.listen(img, 'load', callback);\n // We only listen to the `error` event to remove the `load` event listener because it will not be\n // fired if the image fails to load. This is done to prevent memory leaks in development mode\n // because image elements aren't garbage-collected properly. It happens because zone.js stores the\n // event listener directly on the element and closures capture `dir`.\n const removeErrorListenerFn = renderer.listen(img, 'error', () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n });\n callOnLoadIfImageIsLoaded(img, callback);\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map((attr) => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const callback = () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n };\n const removeLoadListenerFn = renderer.listen(img, 'load', callback);\n // See comments in the `assertNoImageDistortion`.\n const removeErrorListenerFn = renderer.listen(img, 'error', () => {\n removeLoadListenerFn();\n removeErrorListenerFn();\n });\n callOnLoadIfImageIsLoaded(img, callback);\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n/**\n * Warns if the priority attribute is used too often on page load\n */\nasync function assetPriorityCountBelowThreshold(appRef) {\n if (IMGS_WITH_PRIORITY_ATTR_COUNT === 0) {\n IMGS_WITH_PRIORITY_ATTR_COUNT++;\n await ɵwhenStable(appRef);\n if (IMGS_WITH_PRIORITY_ATTR_COUNT > PRIORITY_COUNT_THRESHOLD) {\n console.warn(ɵformatRuntimeError(2966 /* RuntimeErrorCode.TOO_MANY_PRIORITY_ATTRIBUTES */, `NgOptimizedImage: The \"priority\" attribute is set to true more than ${PRIORITY_COUNT_THRESHOLD} times (${IMGS_WITH_PRIORITY_ATTR_COUNT} times). ` +\n `Marking too many images as \"high\" priority can hurt your application's LCP (https://web.dev/lcp). ` +\n `\"Priority\" should only be set on the image expected to be the page's LCP element.`));\n }\n }\n else {\n IMGS_WITH_PRIORITY_ATTR_COUNT++;\n }\n}\n/**\n * Warns if placeholder's dimension are over a threshold.\n *\n * This assert function is meant to only run on the browser.\n */\nfunction assertPlaceholderDimensions(dir, imgElement) {\n const computedStyle = window.getComputedStyle(imgElement);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n if (renderedWidth > PLACEHOLDER_DIMENSION_LIMIT || renderedHeight > PLACEHOLDER_DIMENSION_LIMIT) {\n console.warn(ɵformatRuntimeError(2967 /* RuntimeErrorCode.PLACEHOLDER_DIMENSION_LIMIT_EXCEEDED */, `${imgDirectiveDetails(dir.ngSrc)} it uses a placeholder image, but at least one ` +\n `of the dimensions attribute (height or width) exceeds the limit of ${PLACEHOLDER_DIMENSION_LIMIT}px. ` +\n `To fix this, use a smaller image as a placeholder.`));\n }\n}\nfunction callOnLoadIfImageIsLoaded(img, callback) {\n // https://html.spec.whatwg.org/multipage/embedded-content.html#dom-img-complete\n // The spec defines that `complete` is truthy once its request state is fully available.\n // The image may already be available if it’s loaded from the browser cache.\n // In that case, the `load` event will not fire at all, meaning that all setup\n // callbacks listening for the `load` event will not be invoked.\n // In Safari, there is a known behavior where the `complete` property of an\n // `HTMLImageElement` may sometimes return `true` even when the image is not fully loaded.\n // Checking both `img.complete` and `img.naturalWidth` is the most reliable way to\n // determine if an image has been fully loaded, especially in browsers where the\n // `complete` property may return `true` prematurely.\n if (img.complete && img.naturalWidth) {\n callback();\n }\n}\nfunction round(input) {\n return Number.isInteger(input) ? input : input.toFixed(2);\n}\n// Transform function to handle SafeValue input for ngSrc. This doesn't do any sanitization,\n// as that is not needed for img.src and img.srcset. This transform is purely for compatibility.\nfunction unwrapSafeUrl(value) {\n if (typeof value === 'string') {\n return value;\n }\n return ɵunwrapSafeValue(value);\n}\n// Transform function to handle inputs which may be booleans, strings, or string representations\n// of boolean values. Used for the placeholder attribute.\nfunction booleanOrUrlAttribute(value) {\n if (typeof value === 'string' && value !== 'true' && value !== 'false' && value !== '') {\n return value;\n }\n return booleanAttribute(value);\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, provideNetlifyLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PlatformNavigation as ɵPlatformNavigation, getDOM as ɵgetDOM, normalizeQueryParams as ɵnormalizeQueryParams, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v18.2.8\n * (c) 2010-2024 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, inject, NgZone, runInInjectionContext, InjectionToken, ɵPendingTasks, PLATFORM_ID, ɵConsole, ɵformatRuntimeError, Inject, ɵRuntimeError, makeEnvironmentProviders, NgModule, TransferState, makeStateKey, ɵperformanceMarkFeature, APP_BOOTSTRAP_LISTENER, ApplicationRef, ɵwhenStable, ɵtruncateMiddle } from '@angular/core';\nimport { of, Observable, from } from 'rxjs';\nimport { concatMap, filter, map, finalize, switchMap, tap } from 'rxjs/operators';\nimport * as i1 from '@angular/common';\nimport { isPlatformServer, DOCUMENT, ɵparseCookieValue } from '@angular/common';\n\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach((line) => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else if (typeof Headers !== 'undefined' && headers instanceof Headers) {\n this.headers = new Map();\n headers.forEach((values, name) => {\n this.setHeaderEntries(name, values);\n });\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.entries(headers).forEach(([name, values]) => {\n this.setHeaderEntries(name, values);\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach((update) => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach((key) => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit = !!this.lazyInit && this.lazyInit instanceof HttpHeaders ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter((value) => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n setHeaderEntries(name, values) {\n const headerValues = (Array.isArray(values) ? values : [values]).map((value) => value.toString());\n const key = name.toLowerCase();\n this.headers.set(key, headerValues);\n this.maybeSetNormalizedName(name, key);\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys()).forEach((key) => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings, numbers or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (!(typeof value === 'string' || typeof value === 'number') && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string, a number or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1\n ? [codec.decodeKey(param), '']\n : [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach((key) => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach((param) => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach((_value) => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return (this.keys()\n .map((key) => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key)\n .map((value) => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter((param) => param !== '')\n .join('&'));\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach((key) => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach((update) => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = third !== undefined ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n // We do want to assign transferCache even if it's falsy (false is valid value)\n this.transferCache = options.transferCache;\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n this.headers ??= new HttpHeaders();\n // If no context have been passed in, construct a new HttpContext instance.\n this.context ??= new HttpContext();\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : qIdx < url.length - 1 ? '&' : '';\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (typeof this.body === 'string' ||\n isArrayBuffer(this.body) ||\n isBlob(this.body) ||\n isFormData(this.body) ||\n isUrlSearchParams(this.body)) {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' ||\n typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' ||\n typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // Carefully handle the transferCache to differentiate between\n // `false` and `undefined` in the update args.\n const transferCache = update.transferCache ?? this.transferCache;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = update.body !== undefined ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = update.withCredentials ?? this.withCredentials;\n const reportProgress = update.reportProgress ?? this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers = Object.keys(update.setHeaders).reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams).reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n transferCache,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: update.body !== undefined ? update.body : this.body,\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n/**\n * We use these constant to prevent pulling the whole HttpStatusCode enum\n * Those are the only ones referenced directly by the framework\n */\nconst HTTP_STATUS_CODE_OK = 200;\nconst HTTP_STATUS_CODE_NO_CONTENT = 204;\n/**\n * Http status codes.\n * As per https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml\n * @publicApi\n */\nvar HttpStatusCode;\n(function (HttpStatusCode) {\n HttpStatusCode[HttpStatusCode[\"Continue\"] = 100] = \"Continue\";\n HttpStatusCode[HttpStatusCode[\"SwitchingProtocols\"] = 101] = \"SwitchingProtocols\";\n HttpStatusCode[HttpStatusCode[\"Processing\"] = 102] = \"Processing\";\n HttpStatusCode[HttpStatusCode[\"EarlyHints\"] = 103] = \"EarlyHints\";\n HttpStatusCode[HttpStatusCode[\"Ok\"] = 200] = \"Ok\";\n HttpStatusCode[HttpStatusCode[\"Created\"] = 201] = \"Created\";\n HttpStatusCode[HttpStatusCode[\"Accepted\"] = 202] = \"Accepted\";\n HttpStatusCode[HttpStatusCode[\"NonAuthoritativeInformation\"] = 203] = \"NonAuthoritativeInformation\";\n HttpStatusCode[HttpStatusCode[\"NoContent\"] = 204] = \"NoContent\";\n HttpStatusCode[HttpStatusCode[\"ResetContent\"] = 205] = \"ResetContent\";\n HttpStatusCode[HttpStatusCode[\"PartialContent\"] = 206] = \"PartialContent\";\n HttpStatusCode[HttpStatusCode[\"MultiStatus\"] = 207] = \"MultiStatus\";\n HttpStatusCode[HttpStatusCode[\"AlreadyReported\"] = 208] = \"AlreadyReported\";\n HttpStatusCode[HttpStatusCode[\"ImUsed\"] = 226] = \"ImUsed\";\n HttpStatusCode[HttpStatusCode[\"MultipleChoices\"] = 300] = \"MultipleChoices\";\n HttpStatusCode[HttpStatusCode[\"MovedPermanently\"] = 301] = \"MovedPermanently\";\n HttpStatusCode[HttpStatusCode[\"Found\"] = 302] = \"Found\";\n HttpStatusCode[HttpStatusCode[\"SeeOther\"] = 303] = \"SeeOther\";\n HttpStatusCode[HttpStatusCode[\"NotModified\"] = 304] = \"NotModified\";\n HttpStatusCode[HttpStatusCode[\"UseProxy\"] = 305] = \"UseProxy\";\n HttpStatusCode[HttpStatusCode[\"Unused\"] = 306] = \"Unused\";\n HttpStatusCode[HttpStatusCode[\"TemporaryRedirect\"] = 307] = \"TemporaryRedirect\";\n HttpStatusCode[HttpStatusCode[\"PermanentRedirect\"] = 308] = \"PermanentRedirect\";\n HttpStatusCode[HttpStatusCode[\"BadRequest\"] = 400] = \"BadRequest\";\n HttpStatusCode[HttpStatusCode[\"Unauthorized\"] = 401] = \"Unauthorized\";\n HttpStatusCode[HttpStatusCode[\"PaymentRequired\"] = 402] = \"PaymentRequired\";\n HttpStatusCode[HttpStatusCode[\"Forbidden\"] = 403] = \"Forbidden\";\n HttpStatusCode[HttpStatusCode[\"NotFound\"] = 404] = \"NotFound\";\n HttpStatusCode[HttpStatusCode[\"MethodNotAllowed\"] = 405] = \"MethodNotAllowed\";\n HttpStatusCode[HttpStatusCode[\"NotAcceptable\"] = 406] = \"NotAcceptable\";\n HttpStatusCode[HttpStatusCode[\"ProxyAuthenticationRequired\"] = 407] = \"ProxyAuthenticationRequired\";\n HttpStatusCode[HttpStatusCode[\"RequestTimeout\"] = 408] = \"RequestTimeout\";\n HttpStatusCode[HttpStatusCode[\"Conflict\"] = 409] = \"Conflict\";\n HttpStatusCode[HttpStatusCode[\"Gone\"] = 410] = \"Gone\";\n HttpStatusCode[HttpStatusCode[\"LengthRequired\"] = 411] = \"LengthRequired\";\n HttpStatusCode[HttpStatusCode[\"PreconditionFailed\"] = 412] = \"PreconditionFailed\";\n HttpStatusCode[HttpStatusCode[\"PayloadTooLarge\"] = 413] = \"PayloadTooLarge\";\n HttpStatusCode[HttpStatusCode[\"UriTooLong\"] = 414] = \"UriTooLong\";\n HttpStatusCode[HttpStatusCode[\"UnsupportedMediaType\"] = 415] = \"UnsupportedMediaType\";\n HttpStatusCode[HttpStatusCode[\"RangeNotSatisfiable\"] = 416] = \"RangeNotSatisfiable\";\n HttpStatusCode[HttpStatusCode[\"ExpectationFailed\"] = 417] = \"ExpectationFailed\";\n HttpStatusCode[HttpStatusCode[\"ImATeapot\"] = 418] = \"ImATeapot\";\n HttpStatusCode[HttpStatusCode[\"MisdirectedRequest\"] = 421] = \"MisdirectedRequest\";\n HttpStatusCode[HttpStatusCode[\"UnprocessableEntity\"] = 422] = \"UnprocessableEntity\";\n HttpStatusCode[HttpStatusCode[\"Locked\"] = 423] = \"Locked\";\n HttpStatusCode[HttpStatusCode[\"FailedDependency\"] = 424] = \"FailedDependency\";\n HttpStatusCode[HttpStatusCode[\"TooEarly\"] = 425] = \"TooEarly\";\n HttpStatusCode[HttpStatusCode[\"UpgradeRequired\"] = 426] = \"UpgradeRequired\";\n HttpStatusCode[HttpStatusCode[\"PreconditionRequired\"] = 428] = \"PreconditionRequired\";\n HttpStatusCode[HttpStatusCode[\"TooManyRequests\"] = 429] = \"TooManyRequests\";\n HttpStatusCode[HttpStatusCode[\"RequestHeaderFieldsTooLarge\"] = 431] = \"RequestHeaderFieldsTooLarge\";\n HttpStatusCode[HttpStatusCode[\"UnavailableForLegalReasons\"] = 451] = \"UnavailableForLegalReasons\";\n HttpStatusCode[HttpStatusCode[\"InternalServerError\"] = 500] = \"InternalServerError\";\n HttpStatusCode[HttpStatusCode[\"NotImplemented\"] = 501] = \"NotImplemented\";\n HttpStatusCode[HttpStatusCode[\"BadGateway\"] = 502] = \"BadGateway\";\n HttpStatusCode[HttpStatusCode[\"ServiceUnavailable\"] = 503] = \"ServiceUnavailable\";\n HttpStatusCode[HttpStatusCode[\"GatewayTimeout\"] = 504] = \"GatewayTimeout\";\n HttpStatusCode[HttpStatusCode[\"HttpVersionNotSupported\"] = 505] = \"HttpVersionNotSupported\";\n HttpStatusCode[HttpStatusCode[\"VariantAlsoNegotiates\"] = 506] = \"VariantAlsoNegotiates\";\n HttpStatusCode[HttpStatusCode[\"InsufficientStorage\"] = 507] = \"InsufficientStorage\";\n HttpStatusCode[HttpStatusCode[\"LoopDetected\"] = 508] = \"LoopDetected\";\n HttpStatusCode[HttpStatusCode[\"NotExtended\"] = 510] = \"NotExtended\";\n HttpStatusCode[HttpStatusCode[\"NetworkAuthenticationRequired\"] = 511] = \"NetworkAuthenticationRequired\";\n})(HttpStatusCode || (HttpStatusCode = {}));\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n transferCache: options.transferCache,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n * TODO(adev): review\n * @usageNotes\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, options.body !== undefined ? options.body : null, {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n transferCache: options.transferCache,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = (events$.pipe(filter((event) => event instanceof HttpResponse)));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpClient }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: HttpHandler }] });\n\nconst XSSI_PREFIX$1 = /^\\)\\]\\}',?\\n/;\nconst REQUEST_URL_HEADER = `X-Request-URL`;\n/**\n * Determine an appropriate URL for the response, by checking either\n * response url or the X-Request-URL header.\n */\nfunction getResponseUrl$1(response) {\n if (response.url) {\n return response.url;\n }\n // stored as lowercase in the map\n const xRequestUrl = REQUEST_URL_HEADER.toLocaleLowerCase();\n return response.headers.get(xRequestUrl);\n}\n/**\n * Uses `fetch` to send requests to a backend server.\n *\n * This `FetchBackend` requires the support of the\n * [Fetch API](https://developer.mozilla.org/en-US/docs/Web/API/Fetch_API) which is available on all\n * supported browsers and on Node.js v18 or later.\n *\n * @see {@link HttpHandler}\n *\n * @publicApi\n */\nclass FetchBackend {\n constructor() {\n // We use an arrow function to always reference the current global implementation of `fetch`.\n // This is helpful for cases when the global `fetch` implementation is modified by external code,\n // see https://github.com/angular/angular/issues/57527.\n this.fetchImpl = inject(FetchFactory, { optional: true })?.fetch ?? ((...args) => globalThis.fetch(...args));\n this.ngZone = inject(NgZone);\n }\n handle(request) {\n return new Observable((observer) => {\n const aborter = new AbortController();\n this.doRequest(request, aborter.signal, observer).then(noop, (error) => observer.error(new HttpErrorResponse({ error })));\n return () => aborter.abort();\n });\n }\n async doRequest(request, signal, observer) {\n const init = this.createRequestInit(request);\n let response;\n try {\n // Run fetch outside of Angular zone.\n // This is due to Node.js fetch implementation (Undici) which uses a number of setTimeouts to check if\n // the response should eventually timeout which causes extra CD cycles every 500ms\n const fetchPromise = this.ngZone.runOutsideAngular(() => this.fetchImpl(request.urlWithParams, { signal, ...init }));\n // Make sure Zone.js doesn't trigger false-positive unhandled promise\n // error in case the Promise is rejected synchronously. See function\n // description for additional information.\n silenceSuperfluousUnhandledPromiseRejection(fetchPromise);\n // Send the `Sent` event before awaiting the response.\n observer.next({ type: HttpEventType.Sent });\n response = await fetchPromise;\n }\n catch (error) {\n observer.error(new HttpErrorResponse({\n error,\n status: error.status ?? 0,\n statusText: error.statusText,\n url: request.urlWithParams,\n headers: error.headers,\n }));\n return;\n }\n const headers = new HttpHeaders(response.headers);\n const statusText = response.statusText;\n const url = getResponseUrl$1(response) ?? request.urlWithParams;\n let status = response.status;\n let body = null;\n if (request.reportProgress) {\n observer.next(new HttpHeaderResponse({ headers, status, statusText, url }));\n }\n if (response.body) {\n // Read Progress\n const contentLength = response.headers.get('content-length');\n const chunks = [];\n const reader = response.body.getReader();\n let receivedLength = 0;\n let decoder;\n let partialText;\n // We have to check whether the Zone is defined in the global scope because this may be called\n // when the zone is nooped.\n const reqZone = typeof Zone !== 'undefined' && Zone.current;\n // Perform response processing outside of Angular zone to\n // ensure no excessive change detection runs are executed\n // Here calling the async ReadableStreamDefaultReader.read() is responsible for triggering CD\n await this.ngZone.runOutsideAngular(async () => {\n while (true) {\n const { done, value } = await reader.read();\n if (done) {\n break;\n }\n chunks.push(value);\n receivedLength += value.length;\n if (request.reportProgress) {\n partialText =\n request.responseType === 'text'\n ? (partialText ?? '') +\n (decoder ??= new TextDecoder()).decode(value, { stream: true })\n : undefined;\n const reportProgress = () => observer.next({\n type: HttpEventType.DownloadProgress,\n total: contentLength ? +contentLength : undefined,\n loaded: receivedLength,\n partialText,\n });\n reqZone ? reqZone.run(reportProgress) : reportProgress();\n }\n }\n });\n // Combine all chunks.\n const chunksAll = this.concatChunks(chunks, receivedLength);\n try {\n const contentType = response.headers.get('Content-Type') ?? '';\n body = this.parseBody(request, chunksAll, contentType);\n }\n catch (error) {\n // Body loading or parsing failed\n observer.error(new HttpErrorResponse({\n error,\n headers: new HttpHeaders(response.headers),\n status: response.status,\n statusText: response.statusText,\n url: getResponseUrl$1(response) ?? request.urlWithParams,\n }));\n return;\n }\n }\n // Same behavior as the XhrBackend\n if (status === 0) {\n status = body ? HTTP_STATUS_CODE_OK : 0;\n }\n // ok determines whether the response will be transmitted on the event or\n // error channel. Unsuccessful status codes (not 2xx) will always be errors,\n // but a successful status code can still result in an error if the user\n // asked for JSON data and the body cannot be parsed as such.\n const ok = status >= 200 && status < 300;\n if (ok) {\n observer.next(new HttpResponse({\n body,\n headers,\n status,\n statusText,\n url,\n }));\n // The full body has been received and delivered, no further events\n // are possible. This request is complete.\n observer.complete();\n }\n else {\n observer.error(new HttpErrorResponse({\n error: body,\n headers,\n status,\n statusText,\n url,\n }));\n }\n }\n parseBody(request, binContent, contentType) {\n switch (request.responseType) {\n case 'json':\n // stripping the XSSI when present\n const text = new TextDecoder().decode(binContent).replace(XSSI_PREFIX$1, '');\n return text === '' ? null : JSON.parse(text);\n case 'text':\n return new TextDecoder().decode(binContent);\n case 'blob':\n return new Blob([binContent], { type: contentType });\n case 'arraybuffer':\n return binContent.buffer;\n }\n }\n createRequestInit(req) {\n // We could share some of this logic with the XhrBackend\n const headers = {};\n const credentials = req.withCredentials ? 'include' : undefined;\n // Setting all the requested headers.\n req.headers.forEach((name, values) => (headers[name] = values.join(',')));\n // Add an Accept header if one isn't present already.\n if (!req.headers.has('Accept')) {\n headers['Accept'] = 'application/json, text/plain, */*';\n }\n // Auto-detect the Content-Type header if one isn't present already.\n if (!req.headers.has('Content-Type')) {\n const detectedType = req.detectContentTypeHeader();\n // Sometimes Content-Type detection fails.\n if (detectedType !== null) {\n headers['Content-Type'] = detectedType;\n }\n }\n return {\n body: req.serializeBody(),\n method: req.method,\n headers,\n credentials,\n };\n }\n concatChunks(chunks, totalLength) {\n const chunksAll = new Uint8Array(totalLength);\n let position = 0;\n for (const chunk of chunks) {\n chunksAll.set(chunk, position);\n position += chunk.length;\n }\n return chunksAll;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: FetchBackend, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: FetchBackend }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: FetchBackend, decorators: [{\n type: Injectable\n }] });\n/**\n * Abstract class to provide a mocked implementation of `fetch()`\n */\nclass FetchFactory {\n}\nfunction noop() { }\n/**\n * Zone.js treats a rejected promise that has not yet been awaited\n * as an unhandled error. This function adds a noop `.then` to make\n * sure that Zone.js doesn't throw an error if the Promise is rejected\n * synchronously.\n */\nfunction silenceSuperfluousUnhandledPromiseRejection(promise) {\n promise.then(noop, noop);\n}\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n return (initialRequest, finalHandlerFn) => runInInjectionContext(injector, () => interceptorFn(initialRequest, (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)));\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTORS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTOR_FNS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s that are only set in root.\n */\nconst HTTP_ROOT_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_ROOT_INTERCEPTOR_FNS' : '');\n// TODO(atscott): We need a larger discussion about stability and what should contribute to stability.\n// Should the whole interceptor chain contribute to stability or just the backend request #55075?\n// Should HttpClient contribute to stability automatically at all?\nconst REQUESTS_CONTRIBUTE_TO_STABILITY = new InjectionToken(ngDevMode ? 'REQUESTS_CONTRIBUTE_TO_STABILITY' : '', { providedIn: 'root', factory: () => true });\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n const pendingTasks = inject(ɵPendingTasks);\n const contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);\n if (contributeToStability) {\n const taskId = pendingTasks.add();\n return chain(req, handler).pipe(finalize(() => pendingTasks.remove(taskId)));\n }\n else {\n return chain(req, handler);\n }\n };\n}\nlet fetchBackendWarningDisplayed = false;\n/** Internal function to reset the flag in tests */\nfunction resetFetchBackendWarningFlag() {\n fetchBackendWarningDisplayed = false;\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n this.pendingTasks = inject(ɵPendingTasks);\n this.contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);\n // We strongly recommend using fetch backend for HTTP calls when SSR is used\n // for an application. The logic below checks if that's the case and produces\n // a warning otherwise.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !fetchBackendWarningDisplayed) {\n const isServer = isPlatformServer(injector.get(PLATFORM_ID));\n if (isServer && !(this.backend instanceof FetchBackend)) {\n fetchBackendWarningDisplayed = true;\n injector\n .get(ɵConsole)\n .warn(ɵformatRuntimeError(2801 /* RuntimeErrorCode.NOT_USING_FETCH_BACKEND_IN_SSR */, 'Angular detected that `HttpClient` is not configured ' +\n \"to use `fetch` APIs. It's strongly recommended to \" +\n 'enable `fetch` for applications that use Server-Side Rendering ' +\n 'for better performance and compatibility. ' +\n 'To enable `fetch`, add the `withFetch()` to the `provideHttpClient()` ' +\n 'call at the root of the application.'));\n }\n }\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set([\n ...this.injector.get(HTTP_INTERCEPTOR_FNS),\n ...this.injector.get(HTTP_ROOT_INTERCEPTOR_FNS, []),\n ]));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n if (this.contributeToStability) {\n const taskId = this.pendingTasks.add();\n return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest)).pipe(finalize(() => this.pendingTasks.remove(taskId)));\n }\n else {\n return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest));\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpInterceptorHandler }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: HttpBackend }, { type: i0.EnvironmentInjector }] });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending
http://example.com/#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined DI token for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken(ngDevMode ? 'appBaseHref' : '');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n * Content to render when condition is\n * true.
Content to render when condition is true.
\n * {{value}}
\n * \n * ...\n *
\n *\n * Loading...
\n * \n * ...\n *
\n * Loading...
\n * \n *
`\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\nclass DatePipe {\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }] });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: NgLocalization }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n standalone: true,\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n // make a differ for whatever type we've been passed in\n this.differ ??= this.differs.find(input).create();\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.KeyValueDiffers }] });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see {@link formatNumber}\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format:Today is {{today | date}}
\n *Or if you prefer, {{today | date:'fullDate'}}
\n *The time is {{today | date:'h:mm a z'}}
\n *\n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n/locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n *
\n *
{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see {@link getCurrencySymbol}\n * @see {@link formatCurrency}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *
{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.8\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.8\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }] });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *